About (4E)-3,3-dimethylhepta-4,6-dien-2-one
(4E)-3,3-dimethylhepta-4,6-dien-2-one (PubChem CID 159409963) has the molecular formula C9H13O+
and a molecular weight of 137.20 g/mol. Its IUPAC name is (4E)-3,3-dimethylhepta-4,6-dien-2-one.
Molecular Properties
| Compound Name | (4E)-3,3-dimethylhepta-4,6-dien-2-one |
| PubChem CID | 159409963 |
| Molecular Formula | C9H13O+ |
| Molecular Weight | 137.20 g/mol |
| Exact Mass | 137.10 |
| IUPAC Name | (4E)-3,3-dimethylhepta-4,6-dien-2-one |
| SMILES | [H]/[C+]=C/C=C/C(C)(C)C(C)=O |
| InChI | InChI=1S/C9H13O/c1-5-6-7-9(3,4)8(2)10/h1,5-7H,2-4H3/q+1/b7-6+ |
| InChIKey | JDMRUWZMZMGSRN-VOTSOKGWSA-N |
| XLogP | 2.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.20 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-3,3-dimethylhepta-4,6-dien-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-3,3-dimethylhepta-4,6-dien-2-one?
The IUPAC name of (4E)-3,3-dimethylhepta-4,6-dien-2-one (CID 159409963) is (4E)-3,3-dimethylhepta-4,6-dien-2-one.
What is the SMILES notation for (4E)-3,3-dimethylhepta-4,6-dien-2-one?
The canonical SMILES for (4E)-3,3-dimethylhepta-4,6-dien-2-one is [H]/[C+]=C/C=C/C(C)(C)C(C)=O.
What is the InChIKey of (4E)-3,3-dimethylhepta-4,6-dien-2-one?
The InChIKey is JDMRUWZMZMGSRN-VOTSOKGWSA-N. The full InChI is InChI=1S/C9H13O/c1-5-6-7-9(3,4)8(2)10/h1,5-7H,2-4H3/q+1/b7-6+.
What are the key properties of (4E)-3,3-dimethylhepta-4,6-dien-2-one?
(4E)-3,3-dimethylhepta-4,6-dien-2-one has a molecular weight of 137.20 g/mol, XLogP of 2.15, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-3,3-dimethylhepta-4,6-dien-2-one is sourced from PubChem (CID 159409963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).