C17H21NO3 — CID 15941015
3-[(2E,7E)-6-[(1E)-buta-1,3-dienyl]deca-2,7,9-trienoyl]-1,3-oxazolidin-2-one (PubChem CID 15941015) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 3-[(2E,7E)-6-[(1E)-buta-1,3-dienyl]deca-2,7,9-trienoyl]-1,3-oxazolidin-2-one.
| Compound Name | 3-[(2E,7E)-6-[(1E)-buta-1,3-dienyl]deca-2,7,9-trienoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 15941015 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 3-[(2E,7E)-6-[(1E)-buta-1,3-dienyl]deca-2,7,9-trienoyl]-1,3-oxazolidin-2-one |
| SMILES | C=C/C=C/C(/C=C/C=C)CC/C=C/C(=O)N1CCOC1=O |
| InChI | InChI=1S/C17H21NO3/c1-3-5-9-15(10-6-4-2)11-7-8-12-16(19)18-13-14-21-17(18)20/h3-6,8-10,12,15H,1-2,7,11,13-14H2/b9-5+,10-6+,12-8+ |
| InChIKey | TVLQPXKYUHSLBX-FUJKHKHKSA-N |
| XLogP | 3.40 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|