About propanoic acid;bis(pyrrolidine-2,5-dione)
propanoic acid;bis(pyrrolidine-2,5-dione) (PubChem CID 159410204) has the molecular formula C11H16N2O6
and a molecular weight of 272.26 g/mol. Its IUPAC name is propanoic acid;bis(pyrrolidine-2,5-dione).
Molecular Properties
| Compound Name | propanoic acid;bis(pyrrolidine-2,5-dione) |
| PubChem CID | 159410204 |
| Molecular Formula | C11H16N2O6 |
| Molecular Weight | 272.26 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | propanoic acid;bis(pyrrolidine-2,5-dione) |
| SMILES | CCC(=O)O.O=C1CCC(=O)N1.O=C1CCC(=O)N1 |
| InChI | InChI=1S/2C4H5NO2.C3H6O2/c2*6-3-1-2-4(7)5-3;1-2-3(4)5/h2*1-2H2,(H,5,6,7);2H2,1H3,(H,4,5) |
| InChIKey | LOMDDDZUQIUBCB-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.26 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze propanoic acid;bis(pyrrolidine-2,5-dione) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propanoic acid;bis(pyrrolidine-2,5-dione)?
The IUPAC name of propanoic acid;bis(pyrrolidine-2,5-dione) (CID 159410204) is propanoic acid;bis(pyrrolidine-2,5-dione).
What is the SMILES notation for propanoic acid;bis(pyrrolidine-2,5-dione)?
The canonical SMILES for propanoic acid;bis(pyrrolidine-2,5-dione) is CCC(=O)O.O=C1CCC(=O)N1.O=C1CCC(=O)N1.
What is the InChIKey of propanoic acid;bis(pyrrolidine-2,5-dione)?
The InChIKey is LOMDDDZUQIUBCB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C4H5NO2.C3H6O2/c2*6-3-1-2-4(7)5-3;1-2-3(4)5/h2*1-2H2,(H,5,6,7);2H2,1H3,(H,4,5).
What are the key properties of propanoic acid;bis(pyrrolidine-2,5-dione)?
propanoic acid;bis(pyrrolidine-2,5-dione) has a molecular weight of 272.26 g/mol, XLogP of -0.67, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for propanoic acid;bis(pyrrolidine-2,5-dione) is sourced from PubChem (CID 159410204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).