C30H37FN4O5 — CID 159410903
N-[3-(cyclopropylmethyl)-7-fluoro-2,4-dioxo-1-propan-2-ylquinazolin-6-yl]-3-[(3E,5E)-6-(hydroxymethyl)-2-oxoocta-3,5,7-trienyl]piperidine-1-carboxamide (PubChem CID 159410903) has the molecular formula C30H37FN4O5 and a molecular weight of 552.65 g/mol. Its IUPAC name is N-[3-(cyclopropylmethyl)-7-fluoro-2,4-dioxo-1-propan-2-ylquinazolin-6-yl]-3-[(3E,5E)-6-(hydroxymethyl)-2-oxoocta-3,5,7-trienyl]piperidine-1-carboxamide.
| Compound Name | N-[3-(cyclopropylmethyl)-7-fluoro-2,4-dioxo-1-propan-2-ylquinazolin-6-yl]-3-[(3E,5E)-6-(hydroxymethyl)-2-oxoocta-3,5,7-trienyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 159410903 |
| Molecular Formula | C30H37FN4O5 |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | N-[3-(cyclopropylmethyl)-7-fluoro-2,4-dioxo-1-propan-2-ylquinazolin-6-yl]-3-[(3E,5E)-6-(hydroxymethyl)-2-oxoocta-3,5,7-trienyl]piperidine-1-carboxamide |
| SMILES | C=C/C(=C\C=C\C(=O)CC1CCCN(C(=O)Nc2cc3c(=O)n(CC4CC4)c(=O)n(C(C)C)c3cc2F)C1)CO |
| InChI | InChI=1S/C30H37FN4O5/c1-4-20(18-36)7-5-9-23(37)13-22-8-6-12-33(16-22)29(39)32-26-14-24-27(15-25(26)31)35(19(2)3)30(40)34(28(24)38)17-21-10-11-21/h4-5,7,9,14-15,19,21-22,36H,1,6,8,10-13,16-18H2,2-3H3,(H,32,39)/b9-5+,20-7+ |
| InChIKey | LOOIMBMHDWDKKF-FZYLNTISSA-N |
| XLogP | 4.16 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|