C15H21Br — CID 159411000
2-(1-bromoethyl)-1,1,3,3-tetramethyl-2H-indene (PubChem CID 159411000) has the molecular formula C15H21Br and a molecular weight of 281.24 g/mol. Its IUPAC name is 2-(1-bromoethyl)-1,1,3,3-tetramethyl-2H-indene.
| Compound Name | 2-(1-bromoethyl)-1,1,3,3-tetramethyl-2H-indene |
|---|---|
| PubChem CID | 159411000 |
| Molecular Formula | C15H21Br |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 2-(1-bromoethyl)-1,1,3,3-tetramethyl-2H-indene |
| SMILES | CC(Br)C1C(C)(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C15H21Br/c1-10(16)13-14(2,3)11-8-6-7-9-12(11)15(13,4)5/h6-10,13H,1-5H3 |
| InChIKey | LOOQTQJRMVEEAD-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|