C24H31F3N6O3 — CID 159411702
3-[(1S)-1-[(2-amino-2-methylpropanoyl)amino]-2-phenylmethoxyethyl]-N-(3,3,3-trifluoropropyl)-[1,2,4]triazolo[4,3-a]pyridine-5-carboxamide;methane (PubChem CID 159411702) has the molecular formula C24H31F3N6O3 and a molecular weight of 508.55 g/mol. Its IUPAC name is 3-[(1S)-1-[(2-amino-2-methylpropanoyl)amino]-2-phenylmethoxyethyl]-N-(3,3,3-trifluoropropyl)-[1,2,4]triazolo[4,3-a]pyridine-5-carboxamide;methane.
| Compound Name | 3-[(1S)-1-[(2-amino-2-methylpropanoyl)amino]-2-phenylmethoxyethyl]-N-(3,3,3-trifluoropropyl)-[1,2,4]triazolo[4,3-a]pyridine-5-carboxamide;methane |
|---|---|
| PubChem CID | 159411702 |
| Molecular Formula | C24H31F3N6O3 |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | 3-[(1S)-1-[(2-amino-2-methylpropanoyl)amino]-2-phenylmethoxyethyl]-N-(3,3,3-trifluoropropyl)-[1,2,4]triazolo[4,3-a]pyridine-5-carboxamide;methane |
| SMILES | C.CC(C)(N)C(=O)N[C@H](COCc1ccccc1)c1nnc2cccc(C(=O)NCCC(F)(F)F)n12 |
| InChI | InChI=1S/C23H27F3N6O3.CH4/c1-22(2,27)21(34)29-16(14-35-13-15-7-4-3-5-8-15)19-31-30-18-10-6-9-17(32(18)19)20(33)28-12-11-23(24,25)26;/h3-10,16H,11-14,27H2,1-2H3,(H,28,33)(H,29,34);1H4/t16-;/m1./s1 |
| InChIKey | LOQRKJGOFPCSEU-PKLMIRHRSA-N |
| XLogP | 3.16 |
| TPSA | 123.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |