C23H23ClIN5O3 — CID 159412496
iodomethane;[(3S)-1-pyridin-4-ylpyrrolidin-3-yl] N-[2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]carbamate (PubChem CID 159412496) has the molecular formula C23H23ClIN5O3 and a molecular weight of 579.83 g/mol. Its IUPAC name is iodomethane;[(3S)-1-pyridin-4-ylpyrrolidin-3-yl] N-[2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]carbamate.
| Compound Name | iodomethane;[(3S)-1-pyridin-4-ylpyrrolidin-3-yl] N-[2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]carbamate |
|---|---|
| PubChem CID | 159412496 |
| Molecular Formula | C23H23ClIN5O3 |
| Molecular Weight | 579.83 g/mol |
| Exact Mass | 579.05 |
| IUPAC Name | iodomethane;[(3S)-1-pyridin-4-ylpyrrolidin-3-yl] N-[2-[(5-chloro-2-pyridinyl)carbamoyl]phenyl]carbamate |
| SMILES | CI.O=C(Nc1ccccc1C(=O)Nc1ccc(Cl)cn1)O[C@H]1CCN(c2ccncc2)C1 |
| InChI | InChI=1S/C22H20ClN5O3.CH3I/c23-15-5-6-20(25-13-15)27-21(29)18-3-1-2-4-19(18)26-22(30)31-17-9-12-28(14-17)16-7-10-24-11-8-16;1-2/h1-8,10-11,13,17H,9,12,14H2,(H,26,30)(H,25,27,29);1H3/t17-;/m0./s1 |
| InChIKey | LOTFEEPVFZHLAJ-LMOVPXPDSA-N |
| XLogP | 5.26 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.83 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|