C30H29F6NO2 — CID 15941490
(3R,5S,8aR)-5-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-3,5-diphenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine (PubChem CID 15941490) has the molecular formula C30H29F6NO2 and a molecular weight of 549.56 g/mol. Its IUPAC name is (3R,5S,8aR)-5-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-3,5-diphenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine.
| Compound Name | (3R,5S,8aR)-5-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-3,5-diphenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine |
|---|---|
| PubChem CID | 15941490 |
| Molecular Formula | C30H29F6NO2 |
| Molecular Weight | 549.56 g/mol |
| Exact Mass | 549.21 |
| IUPAC Name | (3R,5S,8aR)-5-[[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]methyl]-3,5-diphenyl-2,3,6,7,8,8a-hexahydro-[1,3]oxazolo[3,2-a]pyridine |
| SMILES | C[C@@H](OC[C@@]1(c2ccccc2)CCC[C@H]2OC[C@@H](c3ccccc3)N21)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C30H29F6NO2/c1-20(22-15-24(29(31,32)33)17-25(16-22)30(34,35)36)39-19-28(23-11-6-3-7-12-23)14-8-13-27-37(28)26(18-38-27)21-9-4-2-5-10-21/h2-7,9-12,15-17,20,26-27H,8,13-14,18-19H2,1H3/t20-,26+,27-,28-/m1/s1 |
| InChIKey | UHRZBRWUAKGEOL-PLOYFGMMSA-N |
| XLogP | 8.28 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.56 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |