C17H17NO4S2 — CID 15941553
N-[4-[4-(thiiran-2-ylmethylsulfonyl)phenoxy]phenyl]acetamide (PubChem CID 15941553) has the molecular formula C17H17NO4S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is N-[4-[4-(thiiran-2-ylmethylsulfonyl)phenoxy]phenyl]acetamide.
| Compound Name | N-[4-[4-(thiiran-2-ylmethylsulfonyl)phenoxy]phenyl]acetamide |
|---|---|
| PubChem CID | 15941553 |
| Molecular Formula | C17H17NO4S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | N-[4-[4-(thiiran-2-ylmethylsulfonyl)phenoxy]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Oc2ccc(S(=O)(=O)CC3CS3)cc2)cc1 |
| InChI | InChI=1S/C17H17NO4S2/c1-12(19)18-13-2-4-14(5-3-13)22-15-6-8-17(9-7-15)24(20,21)11-16-10-23-16/h2-9,16H,10-11H2,1H3,(H,18,19) |
| InChIKey | QNKSDDQPRLWOEC-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|