C15H22N2OS — CID 159416037
(1S)-2-(tert-butylamino)-1-quinolin-2-ylethanol;sulfane (PubChem CID 159416037) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is (1S)-2-(tert-butylamino)-1-quinolin-2-ylethanol;sulfane.
| Compound Name | (1S)-2-(tert-butylamino)-1-quinolin-2-ylethanol;sulfane |
|---|---|
| PubChem CID | 159416037 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (1S)-2-(tert-butylamino)-1-quinolin-2-ylethanol;sulfane |
| SMILES | CC(C)(C)NC[C@H](O)c1ccc2ccccc2n1.S |
| InChI | InChI=1S/C15H20N2O.H2S/c1-15(2,3)16-10-14(18)13-9-8-11-6-4-5-7-12(11)17-13;/h4-9,14,16,18H,10H2,1-3H3;1H2/t14-;/m0./s1 |
| InChIKey | LPECVYCAMQOABH-UQKRIMTDSA-N |
| XLogP | 2.77 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |