C30H38ClN5O2S — CID 15941663
N-[3-[4-[benzylcarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-6-chloro-2,4-dimethylpyridine-3-carboxamide (PubChem CID 15941663) has the molecular formula C30H38ClN5O2S and a molecular weight of 568.19 g/mol. Its IUPAC name is N-[3-[4-[benzylcarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-6-chloro-2,4-dimethylpyridine-3-carboxamide.
| Compound Name | N-[3-[4-[benzylcarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-6-chloro-2,4-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 15941663 |
| Molecular Formula | C30H38ClN5O2S |
| Molecular Weight | 568.19 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | N-[3-[4-[benzylcarbamoyl(thiophen-3-ylmethyl)amino]piperidin-1-yl]butyl]-6-chloro-2,4-dimethylpyridine-3-carboxamide |
| SMILES | Cc1cc(Cl)nc(C)c1C(=O)NCCC(C)N1CCC(N(Cc2ccsc2)C(=O)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C30H38ClN5O2S/c1-21-17-27(31)34-23(3)28(21)29(37)32-13-9-22(2)35-14-10-26(11-15-35)36(19-25-12-16-39-20-25)30(38)33-18-24-7-5-4-6-8-24/h4-8,12,16-17,20,22,26H,9-11,13-15,18-19H2,1-3H3,(H,32,37)(H,33,38) |
| InChIKey | FRHQEUJNKSSMOC-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.19 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|