diethyl 2,6-diethyl-1-phenyl-4H-pyridine-3,5-dicarboxylate

C21H27NO4 — CID 159419056

IUPACdiethyl 2,6-diethyl-1-phenyl-4H-pyridine-3,5-dicarboxylate
SMILESCCOC(=O)C1=C(CC)N(c2ccccc2)C(CC)=C(C(=O)OCC)C1
InChIInChI=1S/C21H27NO4/c1-5-18-16(20(23)25-7-3)14-17(21(24)26-8-4)19(6-2)22(18)15-12-10-9-11-13-15/h9-13H,5-8,14H2,1-4H3
InChIKeyLPNNJGDKNKHXGF-UHFFFAOYSA-N
MW357.45 g/mol
LogP4.35
Rot. Bonds7

About diethyl 2,6-diethyl-1-phenyl-4H-pyridine-3,5-dicarboxylate

diethyl 2,6-diethyl-1-phenyl-4H-pyridine-3,5-dicarboxylate (PubChem CID 159419056) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is diethyl 2,6-diethyl-1-phenyl-4H-pyridine-3,5-dicarboxylate.

Molecular Properties

Compound Namediethyl 2,6-diethyl-1-phenyl-4H-pyridine-3,5-dicarboxylate
PubChem CID159419056
Molecular FormulaC21H27NO4
Molecular Weight357.45 g/mol
Exact Mass357.19
IUPAC Namediethyl 2,6-diethyl-1-phenyl-4H-pyridine-3,5-dicarboxylate
SMILESCCOC(=O)C1=C(CC)N(c2ccccc2)C(CC)=C(C(=O)OCC)C1
InChIInChI=1S/C21H27NO4/c1-5-18-16(20(23)25-7-3)14-17(21(24)26-8-4)19(6-2)22(18)15-12-10-9-11-13-15/h9-13H,5-8,14H2,1-4H3
InChIKeyLPNNJGDKNKHXGF-UHFFFAOYSA-N
XLogP4.35
TPSA55.84 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500357.45
LogP ≤ 54.35
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze diethyl 2,6-diethyl-1-phenyl-4H-pyridine-3,5-dicarboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of diethyl 2,6-diethyl-1-phenyl-4H-pyridine-3,5-dicarboxylate?
The IUPAC name of diethyl 2,6-diethyl-1-phenyl-4H-pyridine-3,5-dicarboxylate (CID 159419056) is diethyl 2,6-diethyl-1-phenyl-4H-pyridine-3,5-dicarboxylate.
What is the SMILES notation for diethyl 2,6-diethyl-1-phenyl-4H-pyridine-3,5-dicarboxylate?
The canonical SMILES for diethyl 2,6-diethyl-1-phenyl-4H-pyridine-3,5-dicarboxylate is CCOC(=O)C1=C(CC)N(c2ccccc2)C(CC)=C(C(=O)OCC)C1.
What is the InChIKey of diethyl 2,6-diethyl-1-phenyl-4H-pyridine-3,5-dicarboxylate?
The InChIKey is LPNNJGDKNKHXGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27NO4/c1-5-18-16(20(23)25-7-3)14-17(21(24)26-8-4)19(6-2)22(18)15-12-10-9-11-13-15/h9-13H,5-8,14H2,1-4H3.
What are the key properties of diethyl 2,6-diethyl-1-phenyl-4H-pyridine-3,5-dicarboxylate?
diethyl 2,6-diethyl-1-phenyl-4H-pyridine-3,5-dicarboxylate has a molecular weight of 357.45 g/mol, XLogP of 4.35, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2,6-diethyl-1-phenyl-4H-pyridine-3,5-dicarboxylate is sourced from PubChem (CID 159419056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).