C21H27NO4 — CID 159419056
diethyl 2,6-diethyl-1-phenyl-4H-pyridine-3,5-dicarboxylate (PubChem CID 159419056) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is diethyl 2,6-diethyl-1-phenyl-4H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2,6-diethyl-1-phenyl-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 159419056 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | diethyl 2,6-diethyl-1-phenyl-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(CC)N(c2ccccc2)C(CC)=C(C(=O)OCC)C1 |
| InChI | InChI=1S/C21H27NO4/c1-5-18-16(20(23)25-7-3)14-17(21(24)26-8-4)19(6-2)22(18)15-12-10-9-11-13-15/h9-13H,5-8,14H2,1-4H3 |
| InChIKey | LPNNJGDKNKHXGF-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |