About N-[3-[(4-fluorophenoxy)methyl]cyclobutyl]-3-phenyl-1,2-oxazole-5-carboxamide;methane
N-[3-[(4-fluorophenoxy)methyl]cyclobutyl]-3-phenyl-1,2-oxazole-5-carboxamide;methane (PubChem CID 159422237) has the molecular formula C22H23FN2O3
and a molecular weight of 382.44 g/mol. Its IUPAC name is N-[3-[(4-fluorophenoxy)methyl]cyclobutyl]-3-phenyl-1,2-oxazole-5-carboxamide;methane.
Molecular Properties
| Compound Name | N-[3-[(4-fluorophenoxy)methyl]cyclobutyl]-3-phenyl-1,2-oxazole-5-carboxamide;methane |
| PubChem CID | 159422237 |
| Molecular Formula | C22H23FN2O3 |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | N-[3-[(4-fluorophenoxy)methyl]cyclobutyl]-3-phenyl-1,2-oxazole-5-carboxamide;methane |
| SMILES | C.O=C(NC1CC(COc2ccc(F)cc2)C1)c1cc(-c2ccccc2)no1 |
| InChI | InChI=1S/C21H19FN2O3.CH4/c22-16-6-8-18(9-7-16)26-13-14-10-17(11-14)23-21(25)20-12-19(24-27-20)15-4-2-1-3-5-15;/h1-9,12,14,17H,10-11,13H2,(H,23,25);1H4 |
| InChIKey | LPXGGIYBUNOHHM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3-[(4-fluorophenoxy)methyl]cyclobutyl]-3-phenyl-1,2-oxazole-5-carboxamide;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[(4-fluorophenoxy)methyl]cyclobutyl]-3-phenyl-1,2-oxazole-5-carboxamide;methane?
The IUPAC name of N-[3-[(4-fluorophenoxy)methyl]cyclobutyl]-3-phenyl-1,2-oxazole-5-carboxamide;methane (CID 159422237) is N-[3-[(4-fluorophenoxy)methyl]cyclobutyl]-3-phenyl-1,2-oxazole-5-carboxamide;methane.
What is the SMILES notation for N-[3-[(4-fluorophenoxy)methyl]cyclobutyl]-3-phenyl-1,2-oxazole-5-carboxamide;methane?
The canonical SMILES for N-[3-[(4-fluorophenoxy)methyl]cyclobutyl]-3-phenyl-1,2-oxazole-5-carboxamide;methane is C.O=C(NC1CC(COc2ccc(F)cc2)C1)c1cc(-c2ccccc2)no1.
What is the InChIKey of N-[3-[(4-fluorophenoxy)methyl]cyclobutyl]-3-phenyl-1,2-oxazole-5-carboxamide;methane?
The InChIKey is LPXGGIYBUNOHHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19FN2O3.CH4/c22-16-6-8-18(9-7-16)26-13-14-10-17(11-14)23-21(25)20-12-19(24-27-20)15-4-2-1-3-5-15;/h1-9,12,14,17H,10-11,13H2,(H,23,25);1H4.
What are the key properties of N-[3-[(4-fluorophenoxy)methyl]cyclobutyl]-3-phenyl-1,2-oxazole-5-carboxamide;methane?
N-[3-[(4-fluorophenoxy)methyl]cyclobutyl]-3-phenyl-1,2-oxazole-5-carboxamide;methane has a molecular weight of 382.44 g/mol, XLogP of 4.70, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[(4-fluorophenoxy)methyl]cyclobutyl]-3-phenyl-1,2-oxazole-5-carboxamide;methane is sourced from PubChem (CID 159422237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).