C23H27N3O2 — CID 159423180
1-(3-cyclopropyl-1,4-dimethylpyrazolo[5,4-b]pyridin-6-yl)oxy-6-phenylhexan-2-one (PubChem CID 159423180) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 1-(3-cyclopropyl-1,4-dimethylpyrazolo[5,4-b]pyridin-6-yl)oxy-6-phenylhexan-2-one.
| Compound Name | 1-(3-cyclopropyl-1,4-dimethylpyrazolo[5,4-b]pyridin-6-yl)oxy-6-phenylhexan-2-one |
|---|---|
| PubChem CID | 159423180 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 1-(3-cyclopropyl-1,4-dimethylpyrazolo[5,4-b]pyridin-6-yl)oxy-6-phenylhexan-2-one |
| SMILES | Cc1cc(OCC(=O)CCCCc2ccccc2)nc2c1c(C1CC1)nn2C |
| InChI | InChI=1S/C23H27N3O2/c1-16-14-20(24-23-21(16)22(18-12-13-18)25-26(23)2)28-15-19(27)11-7-6-10-17-8-4-3-5-9-17/h3-5,8-9,14,18H,6-7,10-13,15H2,1-2H3 |
| InChIKey | LQACEHGJVBGWKF-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|