About tert-butyl (3R)-3-(2,5-dibromophenyl)-4-(3,5-difluorophenyl)butanoate
tert-butyl (3R)-3-(2,5-dibromophenyl)-4-(3,5-difluorophenyl)butanoate (PubChem CID 159424365) has the molecular formula C20H20Br2F2O2
and a molecular weight of 490.18 g/mol. Its IUPAC name is tert-butyl (3R)-3-(2,5-dibromophenyl)-4-(3,5-difluorophenyl)butanoate.
Molecular Properties
| Compound Name | tert-butyl (3R)-3-(2,5-dibromophenyl)-4-(3,5-difluorophenyl)butanoate |
| PubChem CID | 159424365 |
| Molecular Formula | C20H20Br2F2O2 |
| Molecular Weight | 490.18 g/mol |
| Exact Mass | 487.98 |
| IUPAC Name | tert-butyl (3R)-3-(2,5-dibromophenyl)-4-(3,5-difluorophenyl)butanoate |
| SMILES | CC(C)(C)OC(=O)C[C@@H](Cc1cc(F)cc(F)c1)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C20H20Br2F2O2/c1-20(2,3)26-19(25)9-13(17-10-14(21)4-5-18(17)22)6-12-7-15(23)11-16(24)8-12/h4-5,7-8,10-11,13H,6,9H2,1-3H3/t13-/m1/s1 |
| InChIKey | LQDXIZTWYKJCCV-CYBMUJFWSA-N |
| XLogP | 6.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.18 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tert-butyl (3R)-3-(2,5-dibromophenyl)-4-(3,5-difluorophenyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (3R)-3-(2,5-dibromophenyl)-4-(3,5-difluorophenyl)butanoate?
The IUPAC name of tert-butyl (3R)-3-(2,5-dibromophenyl)-4-(3,5-difluorophenyl)butanoate (CID 159424365) is tert-butyl (3R)-3-(2,5-dibromophenyl)-4-(3,5-difluorophenyl)butanoate.
What is the SMILES notation for tert-butyl (3R)-3-(2,5-dibromophenyl)-4-(3,5-difluorophenyl)butanoate?
The canonical SMILES for tert-butyl (3R)-3-(2,5-dibromophenyl)-4-(3,5-difluorophenyl)butanoate is CC(C)(C)OC(=O)C[C@@H](Cc1cc(F)cc(F)c1)c1cc(Br)ccc1Br.
What is the InChIKey of tert-butyl (3R)-3-(2,5-dibromophenyl)-4-(3,5-difluorophenyl)butanoate?
The InChIKey is LQDXIZTWYKJCCV-CYBMUJFWSA-N. The full InChI is InChI=1S/C20H20Br2F2O2/c1-20(2,3)26-19(25)9-13(17-10-14(21)4-5-18(17)22)6-12-7-15(23)11-16(24)8-12/h4-5,7-8,10-11,13H,6,9H2,1-3H3/t13-/m1/s1.
What are the key properties of tert-butyl (3R)-3-(2,5-dibromophenyl)-4-(3,5-difluorophenyl)butanoate?
tert-butyl (3R)-3-(2,5-dibromophenyl)-4-(3,5-difluorophenyl)butanoate has a molecular weight of 490.18 g/mol, XLogP of 6.55, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (3R)-3-(2,5-dibromophenyl)-4-(3,5-difluorophenyl)butanoate is sourced from PubChem (CID 159424365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).