About [2-(acetyloxymethyl)-2-(hydroxymethyl)butyl] acetate;(ethoxycarbonylamino)methyl acetate
[2-(acetyloxymethyl)-2-(hydroxymethyl)butyl] acetate;(ethoxycarbonylamino)methyl acetate (PubChem CID 159424480) has the molecular formula C16H29NO9
and a molecular weight of 379.41 g/mol. Its IUPAC name is [2-(acetyloxymethyl)-2-(hydroxymethyl)butyl] acetate;(ethoxycarbonylamino)methyl acetate.
Molecular Properties
| Compound Name | [2-(acetyloxymethyl)-2-(hydroxymethyl)butyl] acetate;(ethoxycarbonylamino)methyl acetate |
| PubChem CID | 159424480 |
| Molecular Formula | C16H29NO9 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | [2-(acetyloxymethyl)-2-(hydroxymethyl)butyl] acetate;(ethoxycarbonylamino)methyl acetate |
| SMILES | CCC(CO)(COC(C)=O)COC(C)=O.CCOC(=O)NCOC(C)=O |
| InChI | InChI=1S/C10H18O5.C6H11NO4/c1-4-10(5-11,6-14-8(2)12)7-15-9(3)13;1-3-10-6(9)7-4-11-5(2)8/h11H,4-7H2,1-3H3;3-4H2,1-2H3,(H,7,9) |
| InChIKey | LQEHIJVOAPDBAY-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [2-(acetyloxymethyl)-2-(hydroxymethyl)butyl] acetate;(ethoxycarbonylamino)methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(acetyloxymethyl)-2-(hydroxymethyl)butyl] acetate;(ethoxycarbonylamino)methyl acetate?
The IUPAC name of [2-(acetyloxymethyl)-2-(hydroxymethyl)butyl] acetate;(ethoxycarbonylamino)methyl acetate (CID 159424480) is [2-(acetyloxymethyl)-2-(hydroxymethyl)butyl] acetate;(ethoxycarbonylamino)methyl acetate.
What is the SMILES notation for [2-(acetyloxymethyl)-2-(hydroxymethyl)butyl] acetate;(ethoxycarbonylamino)methyl acetate?
The canonical SMILES for [2-(acetyloxymethyl)-2-(hydroxymethyl)butyl] acetate;(ethoxycarbonylamino)methyl acetate is CCC(CO)(COC(C)=O)COC(C)=O.CCOC(=O)NCOC(C)=O.
What is the InChIKey of [2-(acetyloxymethyl)-2-(hydroxymethyl)butyl] acetate;(ethoxycarbonylamino)methyl acetate?
The InChIKey is LQEHIJVOAPDBAY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O5.C6H11NO4/c1-4-10(5-11,6-14-8(2)12)7-15-9(3)13;1-3-10-6(9)7-4-11-5(2)8/h11H,4-7H2,1-3H3;3-4H2,1-2H3,(H,7,9).
What are the key properties of [2-(acetyloxymethyl)-2-(hydroxymethyl)butyl] acetate;(ethoxycarbonylamino)methyl acetate?
[2-(acetyloxymethyl)-2-(hydroxymethyl)butyl] acetate;(ethoxycarbonylamino)methyl acetate has a molecular weight of 379.41 g/mol, XLogP of 0.75, 9 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(acetyloxymethyl)-2-(hydroxymethyl)butyl] acetate;(ethoxycarbonylamino)methyl acetate is sourced from PubChem (CID 159424480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).