C31H24Cl3N7O — CID 159424920
2-[6-chloro-4-(4-methylphenyl)quinazolin-2-yl]-1-hydroxyguanidine;2,6-dichloro-4-(4-methylphenyl)quinazoline (PubChem CID 159424920) has the molecular formula C31H24Cl3N7O and a molecular weight of 616.94 g/mol. Its IUPAC name is 2-[6-chloro-4-(4-methylphenyl)quinazolin-2-yl]-1-hydroxyguanidine;2,6-dichloro-4-(4-methylphenyl)quinazoline.
| Compound Name | 2-[6-chloro-4-(4-methylphenyl)quinazolin-2-yl]-1-hydroxyguanidine;2,6-dichloro-4-(4-methylphenyl)quinazoline |
|---|---|
| PubChem CID | 159424920 |
| Molecular Formula | C31H24Cl3N7O |
| Molecular Weight | 616.94 g/mol |
| Exact Mass | 615.11 |
| IUPAC Name | 2-[6-chloro-4-(4-methylphenyl)quinazolin-2-yl]-1-hydroxyguanidine;2,6-dichloro-4-(4-methylphenyl)quinazoline |
| SMILES | Cc1ccc(-c2nc(Cl)nc3ccc(Cl)cc23)cc1.Cc1ccc(-c2nc(N=C(N)NO)nc3ccc(Cl)cc23)cc1 |
| InChI | InChI=1S/C16H14ClN5O.C15H10Cl2N2/c1-9-2-4-10(5-3-9)14-12-8-11(17)6-7-13(12)19-16(20-14)21-15(18)22-23;1-9-2-4-10(5-3-9)14-12-8-11(16)6-7-13(12)18-15(17)19-14/h2-8,23H,1H3,(H3,18,19,20,21,22);2-8H,1H3 |
| InChIKey | LQFPMJUSWXVODD-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 122.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.94 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|