C19H26N4O2 — CID 159426512
ethyl 3-[(2-methylimino-1,3,5-triazaspiro[5.5]undec-4-en-4-yl)methyl]benzoate (PubChem CID 159426512) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is ethyl 3-[(2-methylimino-1,3,5-triazaspiro[5.5]undec-4-en-4-yl)methyl]benzoate.
| Compound Name | ethyl 3-[(2-methylimino-1,3,5-triazaspiro[5.5]undec-4-en-4-yl)methyl]benzoate |
|---|---|
| PubChem CID | 159426512 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | ethyl 3-[(2-methylimino-1,3,5-triazaspiro[5.5]undec-4-en-4-yl)methyl]benzoate |
| SMILES | CCOC(=O)c1cccc(CC2=NC3(CCCCC3)N/C(=N/C)N2)c1 |
| InChI | InChI=1S/C19H26N4O2/c1-3-25-17(24)15-9-7-8-14(12-15)13-16-21-18(20-2)23-19(22-16)10-5-4-6-11-19/h7-9,12H,3-6,10-11,13H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | CBYNLXUGKIBRNY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 75.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|