C34H28BrN4O2+ — CID 159426556
1-bromo-4-methoxybenzene;5-isocyano-1-(4-methoxyphenyl)-6-methylindole;5-isocyano-6-methyl-1,2-dihydroindol-2-ylium (PubChem CID 159426556) has the molecular formula C34H28BrN4O2+ and a molecular weight of 604.53 g/mol. Its IUPAC name is 1-bromo-4-methoxybenzene;5-isocyano-1-(4-methoxyphenyl)-6-methylindole;5-isocyano-6-methyl-1,2-dihydroindol-2-ylium.
| Compound Name | 1-bromo-4-methoxybenzene;5-isocyano-1-(4-methoxyphenyl)-6-methylindole;5-isocyano-6-methyl-1,2-dihydroindol-2-ylium |
|---|---|
| PubChem CID | 159426556 |
| Molecular Formula | C34H28BrN4O2+ |
| Molecular Weight | 604.53 g/mol |
| Exact Mass | 603.14 |
| IUPAC Name | 1-bromo-4-methoxybenzene;5-isocyano-1-(4-methoxyphenyl)-6-methylindole;5-isocyano-6-methyl-1,2-dihydroindol-2-ylium |
| SMILES | COc1ccc(Br)cc1.[C-]#[N+]c1cc2c(cc1C)N[C+]=C2.[C-]#[N+]c1cc2ccn(-c3ccc(OC)cc3)c2cc1C |
| InChI | InChI=1S/C17H14N2O.C10H7N2.C7H7BrO/c1-12-10-17-13(11-16(12)18-2)8-9-19(17)14-4-6-15(20-3)7-5-14;1-7-5-10-8(3-4-12-10)6-9(7)11-2;1-9-7-4-2-6(8)3-5-7/h4-11H,1,3H3;3,5-6,12H,1H3;2-5H,1H3/q;+1; |
| InChIKey | LQKVAFGSFATYLU-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 44.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.53 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|