About CID 159427339
CID 159427339 (PubChem CID 159427339) has the molecular formula C22H21BBrN4O2
and a molecular weight of 464.15 g/mol.
Molecular Properties
| Compound Name | CID 159427339 |
| PubChem CID | 159427339 |
| Molecular Formula | C22H21BBrN4O2 |
| Molecular Weight | 464.15 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | — |
| SMILES | CBr.Cc1ccnc(-c2ccccn2)c1.O[B]Oc1ccnc(-c2ccccn2)c1 |
| InChI | InChI=1S/C11H10N2.C10H8BN2O2.CH3Br/c1-9-5-7-13-11(8-9)10-4-2-3-6-12-10;14-11-15-8-4-6-13-10(7-8)9-3-1-2-5-12-9;1-2/h2-8H,1H3;1-7,14H;1H3 |
| InChIKey | DHXHDLGKTJACTI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 81.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 464.15 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 159427339 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159427339?
The IUPAC name of CID 159427339 (CID 159427339) is not available.
What is the SMILES notation for CID 159427339?
The canonical SMILES for CID 159427339 is CBr.Cc1ccnc(-c2ccccn2)c1.O[B]Oc1ccnc(-c2ccccn2)c1.
What is the InChIKey of CID 159427339?
The InChIKey is DHXHDLGKTJACTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2.C10H8BN2O2.CH3Br/c1-9-5-7-13-11(8-9)10-4-2-3-6-12-10;14-11-15-8-4-6-13-10(7-8)9-3-1-2-5-12-9;1-2/h2-8H,1H3;1-7,14H;1H3.
What are the key properties of CID 159427339?
CID 159427339 has a molecular weight of 464.15 g/mol, XLogP of 4.51, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159427339 is sourced from PubChem (CID 159427339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).