C22H29NO5 — CID 15942871
(1R,4S,5R)-4-hydroxy-4-(2-hydroxyethyl)-1-[(2E,4E,6E,8E,10Z)-2,6,8,10-tetramethyldodeca-2,4,6,8,10-pentaenoyl]-6-oxa-3-azabicyclo[3.1.0]hexan-2-one (PubChem CID 15942871) has the molecular formula C22H29NO5 and a molecular weight of 387.48 g/mol. Its IUPAC name is (1R,4S,5R)-4-hydroxy-4-(2-hydroxyethyl)-1-[(2E,4E,6E,8E,10Z)-2,6,8,10-tetramethyldodeca-2,4,6,8,10-pentaenoyl]-6-oxa-3-azabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1R,4S,5R)-4-hydroxy-4-(2-hydroxyethyl)-1-[(2E,4E,6E,8E,10Z)-2,6,8,10-tetramethyldodeca-2,4,6,8,10-pentaenoyl]-6-oxa-3-azabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 15942871 |
| Molecular Formula | C22H29NO5 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | (1R,4S,5R)-4-hydroxy-4-(2-hydroxyethyl)-1-[(2E,4E,6E,8E,10Z)-2,6,8,10-tetramethyldodeca-2,4,6,8,10-pentaenoyl]-6-oxa-3-azabicyclo[3.1.0]hexan-2-one |
| SMILES | C/C=C(C)\C=C(C)\C=C(C)\C=C\C=C(/C)C(=O)[C@]12O[C@H]1[C@@](O)(CCO)NC2=O |
| InChI | InChI=1S/C22H29NO5/c1-6-14(2)12-16(4)13-15(3)8-7-9-17(5)18(25)22-19(28-22)21(27,10-11-24)23-20(22)26/h6-9,12-13,19,24,27H,10-11H2,1-5H3,(H,23,26)/b8-7+,14-6-,15-13+,16-12+,17-9+/t19-,21-,22-/m0/s1 |
| InChIKey | RCJADKVBRBVIEX-YAMKEULKSA-N |
| XLogP | 2.26 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|