C23H30N6O3 — CID 159428795
ethane;N-[1-[2-(4-methylpiperazin-1-yl)ethyl]benzimidazol-2-yl]-3-nitrobenzamide (PubChem CID 159428795) has the molecular formula C23H30N6O3 and a molecular weight of 438.53 g/mol. Its IUPAC name is ethane;N-[1-[2-(4-methylpiperazin-1-yl)ethyl]benzimidazol-2-yl]-3-nitrobenzamide.
| Compound Name | ethane;N-[1-[2-(4-methylpiperazin-1-yl)ethyl]benzimidazol-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 159428795 |
| Molecular Formula | C23H30N6O3 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | ethane;N-[1-[2-(4-methylpiperazin-1-yl)ethyl]benzimidazol-2-yl]-3-nitrobenzamide |
| SMILES | CC.CN1CCN(CCn2c(NC(=O)c3cccc([N+](=O)[O-])c3)nc3ccccc32)CC1 |
| InChI | InChI=1S/C21H24N6O3.C2H6/c1-24-9-11-25(12-10-24)13-14-26-19-8-3-2-7-18(19)22-21(26)23-20(28)16-5-4-6-17(15-16)27(29)30;1-2/h2-8,15H,9-14H2,1H3,(H,22,23,28);1-2H3 |
| InChIKey | LQSGVRGNUUQLPS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 96.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|