About CID 159429006
CID 159429006 (PubChem CID 159429006) has the molecular formula C10H24BO2
and a molecular weight of 187.11 g/mol.
Molecular Properties
| Compound Name | CID 159429006 |
| PubChem CID | 159429006 |
| Molecular Formula | C10H24BO2 |
| Molecular Weight | 187.11 g/mol |
| Exact Mass | 187.19 |
| IUPAC Name | — |
| SMILES | C.C.COC(CC(C)C)C(C)=O.[B] |
| InChI | InChI=1S/C8H16O2.2CH4.B/c1-6(2)5-8(10-4)7(3)9;;;/h6,8H,5H2,1-4H3;2*1H4; |
| InChIKey | CMYANWXVKKSQPO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.11 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 159429006 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159429006?
The IUPAC name of CID 159429006 (CID 159429006) is not available.
What is the SMILES notation for CID 159429006?
The canonical SMILES for CID 159429006 is C.C.COC(CC(C)C)C(C)=O.[B].
What is the InChIKey of CID 159429006?
The InChIKey is CMYANWXVKKSQPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.2CH4.B/c1-6(2)5-8(10-4)7(3)9;;;/h6,8H,5H2,1-4H3;2*1H4;.
What are the key properties of CID 159429006?
CID 159429006 has a molecular weight of 187.11 g/mol, XLogP of 2.53, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159429006 is sourced from PubChem (CID 159429006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).