C13H6F5INOY- — CID 159429432
1-(2,2-difluoroethyl)-5-iodo-2-(2,4,6-trifluorophenyl)-3H-pyridin-3-id-6-one;yttrium (PubChem CID 159429432) has the molecular formula C13H6F5INOY- and a molecular weight of 503.00 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-5-iodo-2-(2,4,6-trifluorophenyl)-3H-pyridin-3-id-6-one;yttrium.
| Compound Name | 1-(2,2-difluoroethyl)-5-iodo-2-(2,4,6-trifluorophenyl)-3H-pyridin-3-id-6-one;yttrium |
|---|---|
| PubChem CID | 159429432 |
| Molecular Formula | C13H6F5INOY- |
| Molecular Weight | 503.00 g/mol |
| Exact Mass | 502.85 |
| IUPAC Name | 1-(2,2-difluoroethyl)-5-iodo-2-(2,4,6-trifluorophenyl)-3H-pyridin-3-id-6-one;yttrium |
| SMILES | O=c1c(I)c[c-]c(-c2c(F)cc(F)cc2F)n1CC(F)F.[Y] |
| InChI | InChI=1S/C13H6F5INO.Y/c14-6-3-7(15)12(8(16)4-6)10-2-1-9(19)13(21)20(10)5-11(17)18;/h1,3-4,11H,5H2;/q-1; |
| InChIKey | UZCLBPXWDGIUFC-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.00 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|