C12H12ClNO4S — CID 159430074
3-[(4-chlorophenyl)sulfonylmethyl]piperidine-2,6-dione (PubChem CID 159430074) has the molecular formula C12H12ClNO4S and a molecular weight of 301.75 g/mol. Its IUPAC name is 3-[(4-chlorophenyl)sulfonylmethyl]piperidine-2,6-dione.
| Compound Name | 3-[(4-chlorophenyl)sulfonylmethyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 159430074 |
| Molecular Formula | C12H12ClNO4S |
| Molecular Weight | 301.75 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 3-[(4-chlorophenyl)sulfonylmethyl]piperidine-2,6-dione |
| SMILES | O=C1CCC(CS(=O)(=O)c2ccc(Cl)cc2)C(=O)N1 |
| InChI | InChI=1S/C12H12ClNO4S/c13-9-2-4-10(5-3-9)19(17,18)7-8-1-6-11(15)14-12(8)16/h2-5,8H,1,6-7H2,(H,14,15,16) |
| InChIKey | LQWHIMHUNQNNLT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.75 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|