About 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carboxylic acid
2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carboxylic acid (PubChem CID 15943010) has the molecular formula C8H7N5O2S
and a molecular weight of 237.24 g/mol. Its IUPAC name is 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carboxylic acid |
| PubChem CID | 15943010 |
| Molecular Formula | C8H7N5O2S |
| Molecular Weight | 237.24 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carboxylic acid |
| SMILES | Nc1nc(Sc2ncccc2C(=O)O)n[nH]1 |
| InChI | InChI=1S/C8H7N5O2S/c9-7-11-8(13-12-7)16-5-4(6(14)15)2-1-3-10-5/h1-3H,(H,14,15)(H3,9,11,12,13) |
| InChIKey | OYJQFCUSVVUMME-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 117.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carboxylic acid?
The IUPAC name of 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carboxylic acid (CID 15943010) is 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carboxylic acid.
What is the SMILES notation for 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carboxylic acid?
The canonical SMILES for 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carboxylic acid is Nc1nc(Sc2ncccc2C(=O)O)n[nH]1.
What is the InChIKey of 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carboxylic acid?
The InChIKey is OYJQFCUSVVUMME-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N5O2S/c9-7-11-8(13-12-7)16-5-4(6(14)15)2-1-3-10-5/h1-3H,(H,14,15)(H3,9,11,12,13).
What are the key properties of 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carboxylic acid?
2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carboxylic acid has a molecular weight of 237.24 g/mol, XLogP of 0.63, 3 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-amino-1H-1,2,4-triazol-3-yl)sulfanyl]pyridine-3-carboxylic acid is sourced from PubChem (CID 15943010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).