About (3-amino-2-fluoropropyl) 2-[3-[[1-(1-methylpyrazol-4-yl)-4-oxopyridazin-3-yl]methyl]phenyl]acetate
(3-amino-2-fluoropropyl) 2-[3-[[1-(1-methylpyrazol-4-yl)-4-oxopyridazin-3-yl]methyl]phenyl]acetate (PubChem CID 159430174) has the molecular formula C20H22FN5O3
and a molecular weight of 399.43 g/mol. Its IUPAC name is (3-amino-2-fluoropropyl) 2-[3-[[1-(1-methylpyrazol-4-yl)-4-oxopyridazin-3-yl]methyl]phenyl]acetate.
Molecular Properties
| Compound Name | (3-amino-2-fluoropropyl) 2-[3-[[1-(1-methylpyrazol-4-yl)-4-oxopyridazin-3-yl]methyl]phenyl]acetate |
| PubChem CID | 159430174 |
| Molecular Formula | C20H22FN5O3 |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | (3-amino-2-fluoropropyl) 2-[3-[[1-(1-methylpyrazol-4-yl)-4-oxopyridazin-3-yl]methyl]phenyl]acetate |
| SMILES | Cn1cc(-n2ccc(=O)c(Cc3cccc(CC(=O)OCC(F)CN)c3)n2)cn1 |
| InChI | InChI=1S/C20H22FN5O3/c1-25-12-17(11-23-25)26-6-5-19(27)18(24-26)8-14-3-2-4-15(7-14)9-20(28)29-13-16(21)10-22/h2-7,11-12,16H,8-10,13,22H2,1H3 |
| InChIKey | LQWPDLOUMCBDLN-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 105.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (3-amino-2-fluoropropyl) 2-[3-[[1-(1-methylpyrazol-4-yl)-4-oxopyridazin-3-yl]methyl]phenyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-amino-2-fluoropropyl) 2-[3-[[1-(1-methylpyrazol-4-yl)-4-oxopyridazin-3-yl]methyl]phenyl]acetate?
The IUPAC name of (3-amino-2-fluoropropyl) 2-[3-[[1-(1-methylpyrazol-4-yl)-4-oxopyridazin-3-yl]methyl]phenyl]acetate (CID 159430174) is (3-amino-2-fluoropropyl) 2-[3-[[1-(1-methylpyrazol-4-yl)-4-oxopyridazin-3-yl]methyl]phenyl]acetate.
What is the SMILES notation for (3-amino-2-fluoropropyl) 2-[3-[[1-(1-methylpyrazol-4-yl)-4-oxopyridazin-3-yl]methyl]phenyl]acetate?
The canonical SMILES for (3-amino-2-fluoropropyl) 2-[3-[[1-(1-methylpyrazol-4-yl)-4-oxopyridazin-3-yl]methyl]phenyl]acetate is Cn1cc(-n2ccc(=O)c(Cc3cccc(CC(=O)OCC(F)CN)c3)n2)cn1.
What is the InChIKey of (3-amino-2-fluoropropyl) 2-[3-[[1-(1-methylpyrazol-4-yl)-4-oxopyridazin-3-yl]methyl]phenyl]acetate?
The InChIKey is LQWPDLOUMCBDLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22FN5O3/c1-25-12-17(11-23-25)26-6-5-19(27)18(24-26)8-14-3-2-4-15(7-14)9-20(28)29-13-16(21)10-22/h2-7,11-12,16H,8-10,13,22H2,1H3.
What are the key properties of (3-amino-2-fluoropropyl) 2-[3-[[1-(1-methylpyrazol-4-yl)-4-oxopyridazin-3-yl]methyl]phenyl]acetate?
(3-amino-2-fluoropropyl) 2-[3-[[1-(1-methylpyrazol-4-yl)-4-oxopyridazin-3-yl]methyl]phenyl]acetate has a molecular weight of 399.43 g/mol, XLogP of 0.94, 8 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (3-amino-2-fluoropropyl) 2-[3-[[1-(1-methylpyrazol-4-yl)-4-oxopyridazin-3-yl]methyl]phenyl]acetate is sourced from PubChem (CID 159430174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).