About methanamine;methyl N-methylcarbamate;trichloromethyl carbonochloridate
methanamine;methyl N-methylcarbamate;trichloromethyl carbonochloridate (PubChem CID 159431397) has the molecular formula C6H12Cl4N2O4
and a molecular weight of 317.98 g/mol. Its IUPAC name is methanamine;methyl N-methylcarbamate;trichloromethyl carbonochloridate.
Molecular Properties
| Compound Name | methanamine;methyl N-methylcarbamate;trichloromethyl carbonochloridate |
| PubChem CID | 159431397 |
| Molecular Formula | C6H12Cl4N2O4 |
| Molecular Weight | 317.98 g/mol |
| Exact Mass | 315.96 |
| IUPAC Name | methanamine;methyl N-methylcarbamate;trichloromethyl carbonochloridate |
| SMILES | CN.CNC(=O)OC.O=C(Cl)OC(Cl)(Cl)Cl |
| InChI | InChI=1S/C3H7NO2.C2Cl4O2.CH5N/c1-4-3(5)6-2;3-1(7)8-2(4,5)6;1-2/h1-2H3,(H,4,5);;2H2,1H3 |
| InChIKey | LRAKUGQADTYEEP-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.98 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methanamine;methyl N-methylcarbamate;trichloromethyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;methyl N-methylcarbamate;trichloromethyl carbonochloridate?
The IUPAC name of methanamine;methyl N-methylcarbamate;trichloromethyl carbonochloridate (CID 159431397) is methanamine;methyl N-methylcarbamate;trichloromethyl carbonochloridate.
What is the SMILES notation for methanamine;methyl N-methylcarbamate;trichloromethyl carbonochloridate?
The canonical SMILES for methanamine;methyl N-methylcarbamate;trichloromethyl carbonochloridate is CN.CNC(=O)OC.O=C(Cl)OC(Cl)(Cl)Cl.
What is the InChIKey of methanamine;methyl N-methylcarbamate;trichloromethyl carbonochloridate?
The InChIKey is LRAKUGQADTYEEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO2.C2Cl4O2.CH5N/c1-4-3(5)6-2;3-1(7)8-2(4,5)6;1-2/h1-2H3,(H,4,5);;2H2,1H3.
What are the key properties of methanamine;methyl N-methylcarbamate;trichloromethyl carbonochloridate?
methanamine;methyl N-methylcarbamate;trichloromethyl carbonochloridate has a molecular weight of 317.98 g/mol, XLogP of 2.24, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;methyl N-methylcarbamate;trichloromethyl carbonochloridate is sourced from PubChem (CID 159431397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).