About 5-[5-(2,2-difluoropropoxy)-2-pyridinyl]-4-ethylsulfonyl-2-(4-fluorophenyl)-1,3-thiazole
5-[5-(2,2-difluoropropoxy)-2-pyridinyl]-4-ethylsulfonyl-2-(4-fluorophenyl)-1,3-thiazole (PubChem CID 159432532) has the molecular formula C19H17F3N2O3S2
and a molecular weight of 442.48 g/mol. Its IUPAC name is 5-[5-(2,2-difluoropropoxy)-2-pyridinyl]-4-ethylsulfonyl-2-(4-fluorophenyl)-1,3-thiazole.
Molecular Properties
| Compound Name | 5-[5-(2,2-difluoropropoxy)-2-pyridinyl]-4-ethylsulfonyl-2-(4-fluorophenyl)-1,3-thiazole |
| PubChem CID | 159432532 |
| Molecular Formula | C19H17F3N2O3S2 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 5-[5-(2,2-difluoropropoxy)-2-pyridinyl]-4-ethylsulfonyl-2-(4-fluorophenyl)-1,3-thiazole |
| SMILES | CCS(=O)(=O)c1nc(-c2ccc(F)cc2)sc1-c1ccc(OCC(C)(F)F)cn1 |
| InChI | InChI=1S/C19H17F3N2O3S2/c1-3-29(25,26)18-16(28-17(24-18)12-4-6-13(20)7-5-12)15-9-8-14(10-23-15)27-11-19(2,21)22/h4-10H,3,11H2,1-2H3 |
| InChIKey | LRDYJFPXOGRSGA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[5-(2,2-difluoropropoxy)-2-pyridinyl]-4-ethylsulfonyl-2-(4-fluorophenyl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[5-(2,2-difluoropropoxy)-2-pyridinyl]-4-ethylsulfonyl-2-(4-fluorophenyl)-1,3-thiazole?
The IUPAC name of 5-[5-(2,2-difluoropropoxy)-2-pyridinyl]-4-ethylsulfonyl-2-(4-fluorophenyl)-1,3-thiazole (CID 159432532) is 5-[5-(2,2-difluoropropoxy)-2-pyridinyl]-4-ethylsulfonyl-2-(4-fluorophenyl)-1,3-thiazole.
What is the SMILES notation for 5-[5-(2,2-difluoropropoxy)-2-pyridinyl]-4-ethylsulfonyl-2-(4-fluorophenyl)-1,3-thiazole?
The canonical SMILES for 5-[5-(2,2-difluoropropoxy)-2-pyridinyl]-4-ethylsulfonyl-2-(4-fluorophenyl)-1,3-thiazole is CCS(=O)(=O)c1nc(-c2ccc(F)cc2)sc1-c1ccc(OCC(C)(F)F)cn1.
What is the InChIKey of 5-[5-(2,2-difluoropropoxy)-2-pyridinyl]-4-ethylsulfonyl-2-(4-fluorophenyl)-1,3-thiazole?
The InChIKey is LRDYJFPXOGRSGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F3N2O3S2/c1-3-29(25,26)18-16(28-17(24-18)12-4-6-13(20)7-5-12)15-9-8-14(10-23-15)27-11-19(2,21)22/h4-10H,3,11H2,1-2H3.
What are the key properties of 5-[5-(2,2-difluoropropoxy)-2-pyridinyl]-4-ethylsulfonyl-2-(4-fluorophenyl)-1,3-thiazole?
5-[5-(2,2-difluoropropoxy)-2-pyridinyl]-4-ethylsulfonyl-2-(4-fluorophenyl)-1,3-thiazole has a molecular weight of 442.48 g/mol, XLogP of 4.84, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[5-(2,2-difluoropropoxy)-2-pyridinyl]-4-ethylsulfonyl-2-(4-fluorophenyl)-1,3-thiazole is sourced from PubChem (CID 159432532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).