About ethyl 3-oxo-4H-quinoxaline-2-carboxylate;methyl 8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate
ethyl 3-oxo-4H-quinoxaline-2-carboxylate;methyl 8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate (PubChem CID 159432928) has the molecular formula C20H23N3O5
and a molecular weight of 385.42 g/mol. Its IUPAC name is ethyl 3-oxo-4H-quinoxaline-2-carboxylate;methyl 8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-oxo-4H-quinoxaline-2-carboxylate;methyl 8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate |
| PubChem CID | 159432928 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | ethyl 3-oxo-4H-quinoxaline-2-carboxylate;methyl 8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate |
| SMILES | CCOC(=O)c1nc2ccccc2[nH]c1=O.COC(=O)N1C2C=CC1CCC2 |
| InChI | InChI=1S/C11H10N2O3.C9H13NO2/c1-2-16-11(15)9-10(14)13-8-6-4-3-5-7(8)12-9;1-12-9(11)10-7-3-2-4-8(10)6-5-7/h3-6H,2H2,1H3,(H,13,14);5-8H,2-4H2,1H3 |
| InChIKey | LRFDKZOZANURGB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 101.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-oxo-4H-quinoxaline-2-carboxylate;methyl 8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-oxo-4H-quinoxaline-2-carboxylate;methyl 8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate?
The IUPAC name of ethyl 3-oxo-4H-quinoxaline-2-carboxylate;methyl 8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate (CID 159432928) is ethyl 3-oxo-4H-quinoxaline-2-carboxylate;methyl 8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate.
What is the SMILES notation for ethyl 3-oxo-4H-quinoxaline-2-carboxylate;methyl 8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate?
The canonical SMILES for ethyl 3-oxo-4H-quinoxaline-2-carboxylate;methyl 8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate is CCOC(=O)c1nc2ccccc2[nH]c1=O.COC(=O)N1C2C=CC1CCC2.
What is the InChIKey of ethyl 3-oxo-4H-quinoxaline-2-carboxylate;methyl 8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate?
The InChIKey is LRFDKZOZANURGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O3.C9H13NO2/c1-2-16-11(15)9-10(14)13-8-6-4-3-5-7(8)12-9;1-12-9(11)10-7-3-2-4-8(10)6-5-7/h3-6H,2H2,1H3,(H,13,14);5-8H,2-4H2,1H3.
What are the key properties of ethyl 3-oxo-4H-quinoxaline-2-carboxylate;methyl 8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate?
ethyl 3-oxo-4H-quinoxaline-2-carboxylate;methyl 8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate has a molecular weight of 385.42 g/mol, XLogP of 2.65, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-oxo-4H-quinoxaline-2-carboxylate;methyl 8-azabicyclo[3.2.1]oct-6-ene-8-carboxylate is sourced from PubChem (CID 159432928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).