C12H18F3N — CID 159433973
(1E)-N-ethenyl-N,2,4-trimethyl-4-(trifluoromethyl)hexa-1,5-dien-1-amine (PubChem CID 159433973) has the molecular formula C12H18F3N and a molecular weight of 233.28 g/mol. Its IUPAC name is (1E)-N-ethenyl-N,2,4-trimethyl-4-(trifluoromethyl)hexa-1,5-dien-1-amine.
| Compound Name | (1E)-N-ethenyl-N,2,4-trimethyl-4-(trifluoromethyl)hexa-1,5-dien-1-amine |
|---|---|
| PubChem CID | 159433973 |
| Molecular Formula | C12H18F3N |
| Molecular Weight | 233.28 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (1E)-N-ethenyl-N,2,4-trimethyl-4-(trifluoromethyl)hexa-1,5-dien-1-amine |
| SMILES | C=CN(C)/C=C(\C)CC(C)(C=C)C(F)(F)F |
| InChI | InChI=1S/C12H18F3N/c1-6-11(4,12(13,14)15)8-10(3)9-16(5)7-2/h6-7,9H,1-2,8H2,3-5H3/b10-9+ |
| InChIKey | LRIINEAKTBQHIR-MDZDMXLPSA-N |
| XLogP | 4.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|