C15H14O — CID 159435301
3-hexa-1,3,5-trienyl-2H-chromene (PubChem CID 159435301) has the molecular formula C15H14O and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-hexa-1,3,5-trienyl-2H-chromene.
| Compound Name | 3-hexa-1,3,5-trienyl-2H-chromene |
|---|---|
| PubChem CID | 159435301 |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 3-hexa-1,3,5-trienyl-2H-chromene |
| SMILES | C=CC=CC=CC1=Cc2ccccc2OC1 |
| InChI | InChI=1S/C15H14O/c1-2-3-4-5-8-13-11-14-9-6-7-10-15(14)16-12-13/h2-11H,1,12H2 |
| InChIKey | LRMSDFFYXYLAGM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|