About 3-hexa-1,3,5-trienyl-2H-chromene
3-hexa-1,3,5-trienyl-2H-chromene (PubChem CID 159435301) has the molecular formula C15H14O
and a molecular weight of 210.28 g/mol. Its IUPAC name is 3-hexa-1,3,5-trienyl-2H-chromene.
Molecular Properties
| Compound Name | 3-hexa-1,3,5-trienyl-2H-chromene |
| PubChem CID | 159435301 |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | 3-hexa-1,3,5-trienyl-2H-chromene |
| SMILES | C=CC=CC=CC1=Cc2ccccc2OC1 |
| InChI | InChI=1S/C15H14O/c1-2-3-4-5-8-13-11-14-9-6-7-10-15(14)16-12-13/h2-11H,1,12H2 |
| InChIKey | LRMSDFFYXYLAGM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-hexa-1,3,5-trienyl-2H-chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hexa-1,3,5-trienyl-2H-chromene?
The IUPAC name of 3-hexa-1,3,5-trienyl-2H-chromene (CID 159435301) is 3-hexa-1,3,5-trienyl-2H-chromene.
What is the SMILES notation for 3-hexa-1,3,5-trienyl-2H-chromene?
The canonical SMILES for 3-hexa-1,3,5-trienyl-2H-chromene is C=CC=CC=CC1=Cc2ccccc2OC1.
What is the InChIKey of 3-hexa-1,3,5-trienyl-2H-chromene?
The InChIKey is LRMSDFFYXYLAGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O/c1-2-3-4-5-8-13-11-14-9-6-7-10-15(14)16-12-13/h2-11H,1,12H2.
What are the key properties of 3-hexa-1,3,5-trienyl-2H-chromene?
3-hexa-1,3,5-trienyl-2H-chromene has a molecular weight of 210.28 g/mol, XLogP of 3.76, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hexa-1,3,5-trienyl-2H-chromene is sourced from PubChem (CID 159435301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).