C24H28FNO7 — CID 159435766
[(2R,3R)-3-(4-fluorophenyl)butan-2-yl] (2R)-4-[3-(acetyloxymethoxy)-4-methoxy-2-pyridinyl]-2-methyl-4-oxobutanoate (PubChem CID 159435766) has the molecular formula C24H28FNO7 and a molecular weight of 461.49 g/mol. Its IUPAC name is [(2R,3R)-3-(4-fluorophenyl)butan-2-yl] (2R)-4-[3-(acetyloxymethoxy)-4-methoxy-2-pyridinyl]-2-methyl-4-oxobutanoate.
| Compound Name | [(2R,3R)-3-(4-fluorophenyl)butan-2-yl] (2R)-4-[3-(acetyloxymethoxy)-4-methoxy-2-pyridinyl]-2-methyl-4-oxobutanoate |
|---|---|
| PubChem CID | 159435766 |
| Molecular Formula | C24H28FNO7 |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | [(2R,3R)-3-(4-fluorophenyl)butan-2-yl] (2R)-4-[3-(acetyloxymethoxy)-4-methoxy-2-pyridinyl]-2-methyl-4-oxobutanoate |
| SMILES | COc1ccnc(C(=O)C[C@@H](C)C(=O)O[C@H](C)[C@H](C)c2ccc(F)cc2)c1OCOC(C)=O |
| InChI | InChI=1S/C24H28FNO7/c1-14(24(29)33-16(3)15(2)18-6-8-19(25)9-7-18)12-20(28)22-23(32-13-31-17(4)27)21(30-5)10-11-26-22/h6-11,14-16H,12-13H2,1-5H3/t14-,15+,16-/m1/s1 |
| InChIKey | LROFTFDOYFYTJN-OWCLPIDISA-N |
| XLogP | 4.07 |
| TPSA | 101.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|