C41H73NaO6 — CID 159437988
sodium;(5Z,14Z,19S)-19-hydroxyicosa-5,14-dienoate;methyl (5Z,14Z,19S)-19-hydroxyicosa-5,14-dienoate (PubChem CID 159437988) has the molecular formula C41H73NaO6 and a molecular weight of 685.02 g/mol. Its IUPAC name is sodium;(5Z,14Z,19S)-19-hydroxyicosa-5,14-dienoate;methyl (5Z,14Z,19S)-19-hydroxyicosa-5,14-dienoate.
| Compound Name | sodium;(5Z,14Z,19S)-19-hydroxyicosa-5,14-dienoate;methyl (5Z,14Z,19S)-19-hydroxyicosa-5,14-dienoate |
|---|---|
| PubChem CID | 159437988 |
| Molecular Formula | C41H73NaO6 |
| Molecular Weight | 685.02 g/mol |
| Exact Mass | 684.53 |
| IUPAC Name | sodium;(5Z,14Z,19S)-19-hydroxyicosa-5,14-dienoate;methyl (5Z,14Z,19S)-19-hydroxyicosa-5,14-dienoate |
| SMILES | COC(=O)CCC/C=C\CCCCCCC/C=C\CCC[C@H](C)O.C[C@H](O)CCC/C=C\CCCCCCC/C=C\CCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C21H38O3.C20H36O3.Na/c1-20(22)18-16-14-12-10-8-6-4-3-5-7-9-11-13-15-17-19-21(23)24-2;1-19(21)17-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18-20(22)23;/h10-13,20,22H,3-9,14-19H2,1-2H3;9-12,19,21H,2-8,13-18H2,1H3,(H,22,23);/q;;+1/p-1/b12-10-,13-11-;11-9-,12-10-;/t20-;19-;/m00./s1 |
| InChIKey | LRUXOFSWFSQJFK-LUQQCICTSA-M |
| XLogP | 7.03 |
| TPSA | 106.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.02 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|