About 2-[2-(1,3-dioxolan-2-yl)ethyl]-6-methylpyridin-3-amine
2-[2-(1,3-dioxolan-2-yl)ethyl]-6-methylpyridin-3-amine (PubChem CID 159438299) has the molecular formula C11H16N2O2
and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-[2-(1,3-dioxolan-2-yl)ethyl]-6-methylpyridin-3-amine.
Molecular Properties
| Compound Name | 2-[2-(1,3-dioxolan-2-yl)ethyl]-6-methylpyridin-3-amine |
| PubChem CID | 159438299 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2-[2-(1,3-dioxolan-2-yl)ethyl]-6-methylpyridin-3-amine |
| SMILES | Cc1ccc(N)c(CCC2OCCO2)n1 |
| InChI | InChI=1S/C11H16N2O2/c1-8-2-3-9(12)10(13-8)4-5-11-14-6-7-15-11/h2-3,11H,4-7,12H2,1H3 |
| InChIKey | YXGSTRNKKODRBV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(1,3-dioxolan-2-yl)ethyl]-6-methylpyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(1,3-dioxolan-2-yl)ethyl]-6-methylpyridin-3-amine?
The IUPAC name of 2-[2-(1,3-dioxolan-2-yl)ethyl]-6-methylpyridin-3-amine (CID 159438299) is 2-[2-(1,3-dioxolan-2-yl)ethyl]-6-methylpyridin-3-amine.
What is the SMILES notation for 2-[2-(1,3-dioxolan-2-yl)ethyl]-6-methylpyridin-3-amine?
The canonical SMILES for 2-[2-(1,3-dioxolan-2-yl)ethyl]-6-methylpyridin-3-amine is Cc1ccc(N)c(CCC2OCCO2)n1.
What is the InChIKey of 2-[2-(1,3-dioxolan-2-yl)ethyl]-6-methylpyridin-3-amine?
The InChIKey is YXGSTRNKKODRBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2/c1-8-2-3-9(12)10(13-8)4-5-11-14-6-7-15-11/h2-3,11H,4-7,12H2,1H3.
What are the key properties of 2-[2-(1,3-dioxolan-2-yl)ethyl]-6-methylpyridin-3-amine?
2-[2-(1,3-dioxolan-2-yl)ethyl]-6-methylpyridin-3-amine has a molecular weight of 208.26 g/mol, XLogP of 1.28, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(1,3-dioxolan-2-yl)ethyl]-6-methylpyridin-3-amine is sourced from PubChem (CID 159438299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).