C21H48N2 — CID 159440730
4,4-dimethyl-N-propan-2-ylpentan-1-amine;N-(2,2-dimethylpropyl)-3,3-dimethylbutan-1-amine (PubChem CID 159440730) has the molecular formula C21H48N2 and a molecular weight of 328.63 g/mol. Its IUPAC name is 4,4-dimethyl-N-propan-2-ylpentan-1-amine;N-(2,2-dimethylpropyl)-3,3-dimethylbutan-1-amine.
| Compound Name | 4,4-dimethyl-N-propan-2-ylpentan-1-amine;N-(2,2-dimethylpropyl)-3,3-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 159440730 |
| Molecular Formula | C21H48N2 |
| Molecular Weight | 328.63 g/mol |
| Exact Mass | 328.38 |
| IUPAC Name | 4,4-dimethyl-N-propan-2-ylpentan-1-amine;N-(2,2-dimethylpropyl)-3,3-dimethylbutan-1-amine |
| SMILES | CC(C)(C)CCNCC(C)(C)C.CC(C)NCCCC(C)(C)C |
| InChI | InChI=1S/C11H25N.C10H23N/c1-10(2,3)7-8-12-9-11(4,5)6;1-9(2)11-8-6-7-10(3,4)5/h12H,7-9H2,1-6H3;9,11H,6-8H2,1-5H3 |
| InChIKey | LSDFLAHWZHRBGC-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.63 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|