About (2,4-ditert-butyl-4-hydroxycyclohexa-1,5-dien-1-yl) propanoate
(2,4-ditert-butyl-4-hydroxycyclohexa-1,5-dien-1-yl) propanoate (PubChem CID 159440811) has the molecular formula C17H28O3
and a molecular weight of 280.41 g/mol. Its IUPAC name is (2,4-ditert-butyl-4-hydroxycyclohexa-1,5-dien-1-yl) propanoate.
Molecular Properties
| Compound Name | (2,4-ditert-butyl-4-hydroxycyclohexa-1,5-dien-1-yl) propanoate |
| PubChem CID | 159440811 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | (2,4-ditert-butyl-4-hydroxycyclohexa-1,5-dien-1-yl) propanoate |
| SMILES | CCC(=O)OC1=C(C(C)(C)C)CC(O)(C(C)(C)C)C=C1 |
| InChI | InChI=1S/C17H28O3/c1-8-14(18)20-13-9-10-17(19,16(5,6)7)11-12(13)15(2,3)4/h9-10,19H,8,11H2,1-7H3 |
| InChIKey | LSDMMEHTNWGFMH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,4-ditert-butyl-4-hydroxycyclohexa-1,5-dien-1-yl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-ditert-butyl-4-hydroxycyclohexa-1,5-dien-1-yl) propanoate?
The IUPAC name of (2,4-ditert-butyl-4-hydroxycyclohexa-1,5-dien-1-yl) propanoate (CID 159440811) is (2,4-ditert-butyl-4-hydroxycyclohexa-1,5-dien-1-yl) propanoate.
What is the SMILES notation for (2,4-ditert-butyl-4-hydroxycyclohexa-1,5-dien-1-yl) propanoate?
The canonical SMILES for (2,4-ditert-butyl-4-hydroxycyclohexa-1,5-dien-1-yl) propanoate is CCC(=O)OC1=C(C(C)(C)C)CC(O)(C(C)(C)C)C=C1.
What is the InChIKey of (2,4-ditert-butyl-4-hydroxycyclohexa-1,5-dien-1-yl) propanoate?
The InChIKey is LSDMMEHTNWGFMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28O3/c1-8-14(18)20-13-9-10-17(19,16(5,6)7)11-12(13)15(2,3)4/h9-10,19H,8,11H2,1-7H3.
What are the key properties of (2,4-ditert-butyl-4-hydroxycyclohexa-1,5-dien-1-yl) propanoate?
(2,4-ditert-butyl-4-hydroxycyclohexa-1,5-dien-1-yl) propanoate has a molecular weight of 280.41 g/mol, XLogP of 3.98, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-ditert-butyl-4-hydroxycyclohexa-1,5-dien-1-yl) propanoate is sourced from PubChem (CID 159440811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).