About 2-(4-bromophenyl)-2,2-difluoroethanol;[2-(4-bromophenyl)-2,2-difluoroethyl] acetate
2-(4-bromophenyl)-2,2-difluoroethanol;[2-(4-bromophenyl)-2,2-difluoroethyl] acetate (PubChem CID 159440889) has the molecular formula C18H16Br2F4O3
and a molecular weight of 516.12 g/mol. Its IUPAC name is 2-(4-bromophenyl)-2,2-difluoroethanol;[2-(4-bromophenyl)-2,2-difluoroethyl] acetate.
Molecular Properties
| Compound Name | 2-(4-bromophenyl)-2,2-difluoroethanol;[2-(4-bromophenyl)-2,2-difluoroethyl] acetate |
| PubChem CID | 159440889 |
| Molecular Formula | C18H16Br2F4O3 |
| Molecular Weight | 516.12 g/mol |
| Exact Mass | 513.94 |
| IUPAC Name | 2-(4-bromophenyl)-2,2-difluoroethanol;[2-(4-bromophenyl)-2,2-difluoroethyl] acetate |
| SMILES | CC(=O)OCC(F)(F)c1ccc(Br)cc1.OCC(F)(F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H9BrF2O2.C8H7BrF2O/c1-7(14)15-6-10(12,13)8-2-4-9(11)5-3-8;9-7-3-1-6(2-4-7)8(10,11)5-12/h2-5H,6H2,1H3;1-4,12H,5H2 |
| InChIKey | LSDSFJYIONQYHR-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 516.12 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(4-bromophenyl)-2,2-difluoroethanol;[2-(4-bromophenyl)-2,2-difluoroethyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenyl)-2,2-difluoroethanol;[2-(4-bromophenyl)-2,2-difluoroethyl] acetate?
The IUPAC name of 2-(4-bromophenyl)-2,2-difluoroethanol;[2-(4-bromophenyl)-2,2-difluoroethyl] acetate (CID 159440889) is 2-(4-bromophenyl)-2,2-difluoroethanol;[2-(4-bromophenyl)-2,2-difluoroethyl] acetate.
What is the SMILES notation for 2-(4-bromophenyl)-2,2-difluoroethanol;[2-(4-bromophenyl)-2,2-difluoroethyl] acetate?
The canonical SMILES for 2-(4-bromophenyl)-2,2-difluoroethanol;[2-(4-bromophenyl)-2,2-difluoroethyl] acetate is CC(=O)OCC(F)(F)c1ccc(Br)cc1.OCC(F)(F)c1ccc(Br)cc1.
What is the InChIKey of 2-(4-bromophenyl)-2,2-difluoroethanol;[2-(4-bromophenyl)-2,2-difluoroethyl] acetate?
The InChIKey is LSDSFJYIONQYHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrF2O2.C8H7BrF2O/c1-7(14)15-6-10(12,13)8-2-4-9(11)5-3-8;9-7-3-1-6(2-4-7)8(10,11)5-12/h2-5H,6H2,1H3;1-4,12H,5H2.
What are the key properties of 2-(4-bromophenyl)-2,2-difluoroethanol;[2-(4-bromophenyl)-2,2-difluoroethyl] acetate?
2-(4-bromophenyl)-2,2-difluoroethanol;[2-(4-bromophenyl)-2,2-difluoroethyl] acetate has a molecular weight of 516.12 g/mol, XLogP of 5.64, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenyl)-2,2-difluoroethanol;[2-(4-bromophenyl)-2,2-difluoroethyl] acetate is sourced from PubChem (CID 159440889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).