About 2-(2-aminophenyl)-3,4-dimethylcyclopent-2-en-1-one
2-(2-aminophenyl)-3,4-dimethylcyclopent-2-en-1-one (PubChem CID 159441258) has the molecular formula C26H30N2O2
and a molecular weight of 402.54 g/mol. Its IUPAC name is 2-(2-aminophenyl)-3,4-dimethylcyclopent-2-en-1-one.
Molecular Properties
| Compound Name | 2-(2-aminophenyl)-3,4-dimethylcyclopent-2-en-1-one |
| PubChem CID | 159441258 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 2-(2-aminophenyl)-3,4-dimethylcyclopent-2-en-1-one |
| SMILES | CC1=C(c2ccccc2N)C(=O)CC1C.CC1=C(c2ccccc2N)C(=O)CC1C |
| InChI | InChI=1S/2C13H15NO/c2*1-8-7-12(15)13(9(8)2)10-5-3-4-6-11(10)14/h2*3-6,8H,7,14H2,1-2H3 |
| InChIKey | LSEYWNQMVRWEOZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminophenyl)-3,4-dimethylcyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminophenyl)-3,4-dimethylcyclopent-2-en-1-one?
The IUPAC name of 2-(2-aminophenyl)-3,4-dimethylcyclopent-2-en-1-one (CID 159441258) is 2-(2-aminophenyl)-3,4-dimethylcyclopent-2-en-1-one.
What is the SMILES notation for 2-(2-aminophenyl)-3,4-dimethylcyclopent-2-en-1-one?
The canonical SMILES for 2-(2-aminophenyl)-3,4-dimethylcyclopent-2-en-1-one is CC1=C(c2ccccc2N)C(=O)CC1C.CC1=C(c2ccccc2N)C(=O)CC1C.
What is the InChIKey of 2-(2-aminophenyl)-3,4-dimethylcyclopent-2-en-1-one?
The InChIKey is LSEYWNQMVRWEOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C13H15NO/c2*1-8-7-12(15)13(9(8)2)10-5-3-4-6-11(10)14/h2*3-6,8H,7,14H2,1-2H3.
What are the key properties of 2-(2-aminophenyl)-3,4-dimethylcyclopent-2-en-1-one?
2-(2-aminophenyl)-3,4-dimethylcyclopent-2-en-1-one has a molecular weight of 402.54 g/mol, XLogP of 5.30, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminophenyl)-3,4-dimethylcyclopent-2-en-1-one is sourced from PubChem (CID 159441258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).