About methyl 1-[6-(2,6-difluoroanilino)pyrimidin-4-yl]-5-ethylpyrazole-4-carboxylate
methyl 1-[6-(2,6-difluoroanilino)pyrimidin-4-yl]-5-ethylpyrazole-4-carboxylate (PubChem CID 15944235) has the molecular formula C17H15F2N5O2
and a molecular weight of 359.34 g/mol. Its IUPAC name is methyl 1-[6-(2,6-difluoroanilino)pyrimidin-4-yl]-5-ethylpyrazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[6-(2,6-difluoroanilino)pyrimidin-4-yl]-5-ethylpyrazole-4-carboxylate |
| PubChem CID | 15944235 |
| Molecular Formula | C17H15F2N5O2 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | methyl 1-[6-(2,6-difluoroanilino)pyrimidin-4-yl]-5-ethylpyrazole-4-carboxylate |
| SMILES | CCc1c(C(=O)OC)cnn1-c1cc(Nc2c(F)cccc2F)ncn1 |
| InChI | InChI=1S/C17H15F2N5O2/c1-3-13-10(17(25)26-2)8-22-24(13)15-7-14(20-9-21-15)23-16-11(18)5-4-6-12(16)19/h4-9H,3H2,1-2H3,(H,20,21,23) |
| InChIKey | SJBIOKUZYFWVFT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 1-[6-(2,6-difluoroanilino)pyrimidin-4-yl]-5-ethylpyrazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[6-(2,6-difluoroanilino)pyrimidin-4-yl]-5-ethylpyrazole-4-carboxylate?
The IUPAC name of methyl 1-[6-(2,6-difluoroanilino)pyrimidin-4-yl]-5-ethylpyrazole-4-carboxylate (CID 15944235) is methyl 1-[6-(2,6-difluoroanilino)pyrimidin-4-yl]-5-ethylpyrazole-4-carboxylate.
What is the SMILES notation for methyl 1-[6-(2,6-difluoroanilino)pyrimidin-4-yl]-5-ethylpyrazole-4-carboxylate?
The canonical SMILES for methyl 1-[6-(2,6-difluoroanilino)pyrimidin-4-yl]-5-ethylpyrazole-4-carboxylate is CCc1c(C(=O)OC)cnn1-c1cc(Nc2c(F)cccc2F)ncn1.
What is the InChIKey of methyl 1-[6-(2,6-difluoroanilino)pyrimidin-4-yl]-5-ethylpyrazole-4-carboxylate?
The InChIKey is SJBIOKUZYFWVFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15F2N5O2/c1-3-13-10(17(25)26-2)8-22-24(13)15-7-14(20-9-21-15)23-16-11(18)5-4-6-12(16)19/h4-9H,3H2,1-2H3,(H,20,21,23).
What are the key properties of methyl 1-[6-(2,6-difluoroanilino)pyrimidin-4-yl]-5-ethylpyrazole-4-carboxylate?
methyl 1-[6-(2,6-difluoroanilino)pyrimidin-4-yl]-5-ethylpyrazole-4-carboxylate has a molecular weight of 359.34 g/mol, XLogP of 3.03, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[6-(2,6-difluoroanilino)pyrimidin-4-yl]-5-ethylpyrazole-4-carboxylate is sourced from PubChem (CID 15944235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).