C27H24N4O6 — CID 159444376
methyl 3-amino-5-(5-methyl-2-pyridinyl)benzoate;3-(5-methyl-2-pyridinyl)-5-nitrobenzoic acid (PubChem CID 159444376) has the molecular formula C27H24N4O6 and a molecular weight of 500.51 g/mol. Its IUPAC name is methyl 3-amino-5-(5-methyl-2-pyridinyl)benzoate;3-(5-methyl-2-pyridinyl)-5-nitrobenzoic acid.
| Compound Name | methyl 3-amino-5-(5-methyl-2-pyridinyl)benzoate;3-(5-methyl-2-pyridinyl)-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 159444376 |
| Molecular Formula | C27H24N4O6 |
| Molecular Weight | 500.51 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | methyl 3-amino-5-(5-methyl-2-pyridinyl)benzoate;3-(5-methyl-2-pyridinyl)-5-nitrobenzoic acid |
| SMILES | COC(=O)c1cc(N)cc(-c2ccc(C)cn2)c1.Cc1ccc(-c2cc(C(=O)O)cc([N+](=O)[O-])c2)nc1 |
| InChI | InChI=1S/C14H14N2O2.C13H10N2O4/c1-9-3-4-13(16-8-9)10-5-11(14(17)18-2)7-12(15)6-10;1-8-2-3-12(14-7-8)9-4-10(13(16)17)6-11(5-9)15(18)19/h3-8H,15H2,1-2H3;2-7H,1H3,(H,16,17) |
| InChIKey | LSOSDUDWFVOXQE-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 158.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.51 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|