About chloro hypochlorite;1-[1-[3-(3,4-dichlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclobutan-1-ol
chloro hypochlorite;1-[1-[3-(3,4-dichlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclobutan-1-ol (PubChem CID 159444729) has the molecular formula C22H26Cl4N2O2
and a molecular weight of 492.27 g/mol. Its IUPAC name is chloro hypochlorite;1-[1-[3-(3,4-dichlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclobutan-1-ol.
Molecular Properties
| Compound Name | chloro hypochlorite;1-[1-[3-(3,4-dichlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclobutan-1-ol |
| PubChem CID | 159444729 |
| Molecular Formula | C22H26Cl4N2O2 |
| Molecular Weight | 492.27 g/mol |
| Exact Mass | 490.07 |
| IUPAC Name | chloro hypochlorite;1-[1-[3-(3,4-dichlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclobutan-1-ol |
| SMILES | ClOCl.OC1(C(CN2CCNCC2)c2cccc(-c3ccc(Cl)c(Cl)c3)c2)CCC1 |
| InChI | InChI=1S/C22H26Cl2N2O.Cl2O/c23-20-6-5-17(14-21(20)24)16-3-1-4-18(13-16)19(22(27)7-2-8-22)15-26-11-9-25-10-12-26;1-3-2/h1,3-6,13-14,19,25,27H,2,7-12,15H2; |
| InChIKey | LSPUEPDOTDNGKP-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 492.27 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze chloro hypochlorite;1-[1-[3-(3,4-dichlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclobutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro hypochlorite;1-[1-[3-(3,4-dichlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclobutan-1-ol?
The IUPAC name of chloro hypochlorite;1-[1-[3-(3,4-dichlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclobutan-1-ol (CID 159444729) is chloro hypochlorite;1-[1-[3-(3,4-dichlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclobutan-1-ol.
What is the SMILES notation for chloro hypochlorite;1-[1-[3-(3,4-dichlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclobutan-1-ol?
The canonical SMILES for chloro hypochlorite;1-[1-[3-(3,4-dichlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclobutan-1-ol is ClOCl.OC1(C(CN2CCNCC2)c2cccc(-c3ccc(Cl)c(Cl)c3)c2)CCC1.
What is the InChIKey of chloro hypochlorite;1-[1-[3-(3,4-dichlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclobutan-1-ol?
The InChIKey is LSPUEPDOTDNGKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H26Cl2N2O.Cl2O/c23-20-6-5-17(14-21(20)24)16-3-1-4-18(13-16)19(22(27)7-2-8-22)15-26-11-9-25-10-12-26;1-3-2/h1,3-6,13-14,19,25,27H,2,7-12,15H2;.
What are the key properties of chloro hypochlorite;1-[1-[3-(3,4-dichlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclobutan-1-ol?
chloro hypochlorite;1-[1-[3-(3,4-dichlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclobutan-1-ol has a molecular weight of 492.27 g/mol, XLogP of 5.87, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for chloro hypochlorite;1-[1-[3-(3,4-dichlorophenyl)phenyl]-2-piperazin-1-ylethyl]cyclobutan-1-ol is sourced from PubChem (CID 159444729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).