About ethyl 2-[methyl(prop-2-enoyl)amino]acetate;methyl 2-[methyl(prop-2-enoyl)amino]acetate
ethyl 2-[methyl(prop-2-enoyl)amino]acetate;methyl 2-[methyl(prop-2-enoyl)amino]acetate (PubChem CID 159445544) has the molecular formula C15H24N2O6
and a molecular weight of 328.37 g/mol. Its IUPAC name is ethyl 2-[methyl(prop-2-enoyl)amino]acetate;methyl 2-[methyl(prop-2-enoyl)amino]acetate.
Molecular Properties
| Compound Name | ethyl 2-[methyl(prop-2-enoyl)amino]acetate;methyl 2-[methyl(prop-2-enoyl)amino]acetate |
| PubChem CID | 159445544 |
| Molecular Formula | C15H24N2O6 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | ethyl 2-[methyl(prop-2-enoyl)amino]acetate;methyl 2-[methyl(prop-2-enoyl)amino]acetate |
| SMILES | C=CC(=O)N(C)CC(=O)OC.C=CC(=O)N(C)CC(=O)OCC |
| InChI | InChI=1S/C8H13NO3.C7H11NO3/c1-4-7(10)9(3)6-8(11)12-5-2;1-4-6(9)8(2)5-7(10)11-3/h4H,1,5-6H2,2-3H3;4H,1,5H2,2-3H3 |
| InChIKey | LSSFHVQFTCTLBL-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[methyl(prop-2-enoyl)amino]acetate;methyl 2-[methyl(prop-2-enoyl)amino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[methyl(prop-2-enoyl)amino]acetate;methyl 2-[methyl(prop-2-enoyl)amino]acetate?
The IUPAC name of ethyl 2-[methyl(prop-2-enoyl)amino]acetate;methyl 2-[methyl(prop-2-enoyl)amino]acetate (CID 159445544) is ethyl 2-[methyl(prop-2-enoyl)amino]acetate;methyl 2-[methyl(prop-2-enoyl)amino]acetate.
What is the SMILES notation for ethyl 2-[methyl(prop-2-enoyl)amino]acetate;methyl 2-[methyl(prop-2-enoyl)amino]acetate?
The canonical SMILES for ethyl 2-[methyl(prop-2-enoyl)amino]acetate;methyl 2-[methyl(prop-2-enoyl)amino]acetate is C=CC(=O)N(C)CC(=O)OC.C=CC(=O)N(C)CC(=O)OCC.
What is the InChIKey of ethyl 2-[methyl(prop-2-enoyl)amino]acetate;methyl 2-[methyl(prop-2-enoyl)amino]acetate?
The InChIKey is LSSFHVQFTCTLBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3.C7H11NO3/c1-4-7(10)9(3)6-8(11)12-5-2;1-4-6(9)8(2)5-7(10)11-3/h4H,1,5-6H2,2-3H3;4H,1,5H2,2-3H3.
What are the key properties of ethyl 2-[methyl(prop-2-enoyl)amino]acetate;methyl 2-[methyl(prop-2-enoyl)amino]acetate?
ethyl 2-[methyl(prop-2-enoyl)amino]acetate;methyl 2-[methyl(prop-2-enoyl)amino]acetate has a molecular weight of 328.37 g/mol, XLogP of -0.00, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[methyl(prop-2-enoyl)amino]acetate;methyl 2-[methyl(prop-2-enoyl)amino]acetate is sourced from PubChem (CID 159445544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).