C13H17O4- — CID 15944652
3-[(3aS,4S,7aS)-7a-methyl-1,5-dioxo-2,3,3a,4,6,7-hexahydroinden-4-yl]propanoate (PubChem CID 15944652) has the molecular formula C13H17O4- and a molecular weight of 237.27 g/mol. Its IUPAC name is 3-[(3aS,4S,7aS)-7a-methyl-1,5-dioxo-2,3,3a,4,6,7-hexahydroinden-4-yl]propanoate.
| Compound Name | 3-[(3aS,4S,7aS)-7a-methyl-1,5-dioxo-2,3,3a,4,6,7-hexahydroinden-4-yl]propanoate |
|---|---|
| PubChem CID | 15944652 |
| Molecular Formula | C13H17O4- |
| Molecular Weight | 237.27 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | 3-[(3aS,4S,7aS)-7a-methyl-1,5-dioxo-2,3,3a,4,6,7-hexahydroinden-4-yl]propanoate |
| SMILES | C[C@]12CCC(=O)[C@@H](CCC(=O)[O-])[C@@H]1CCC2=O |
| InChI | InChI=1S/C13H18O4/c1-13-7-6-10(14)8(2-5-12(16)17)9(13)3-4-11(13)15/h8-9H,2-7H2,1H3,(H,16,17)/p-1/t8-,9-,13-/m0/s1 |
| InChIKey | PCCFNLPWOFTZPJ-RVBZMBCESA-M |
| XLogP | 0.48 |
| TPSA | 74.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.27 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |