About 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-phenylphenyl)-1,3-thiazole;ethanol
2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-phenylphenyl)-1,3-thiazole;ethanol (PubChem CID 15944745) has the molecular formula C24H27N3OS
and a molecular weight of 405.57 g/mol. Its IUPAC name is 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-phenylphenyl)-1,3-thiazole;ethanol.
Molecular Properties
| Compound Name | 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-phenylphenyl)-1,3-thiazole;ethanol |
| PubChem CID | 15944745 |
| Molecular Formula | C24H27N3OS |
| Molecular Weight | 405.57 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-phenylphenyl)-1,3-thiazole;ethanol |
| SMILES | CCO.Cc1cc(C)n(CCc2nc(-c3ccc(-c4ccccc4)cc3)cs2)n1 |
| InChI | InChI=1S/C22H21N3S.C2H6O/c1-16-14-17(2)25(24-16)13-12-22-23-21(15-26-22)20-10-8-19(9-11-20)18-6-4-3-5-7-18;1-2-3/h3-11,14-15H,12-13H2,1-2H3;3H,2H2,1H3 |
| InChIKey | IWSLPEXWSRVODY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.57 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-phenylphenyl)-1,3-thiazole;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-phenylphenyl)-1,3-thiazole;ethanol?
The IUPAC name of 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-phenylphenyl)-1,3-thiazole;ethanol (CID 15944745) is 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-phenylphenyl)-1,3-thiazole;ethanol.
What is the SMILES notation for 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-phenylphenyl)-1,3-thiazole;ethanol?
The canonical SMILES for 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-phenylphenyl)-1,3-thiazole;ethanol is CCO.Cc1cc(C)n(CCc2nc(-c3ccc(-c4ccccc4)cc3)cs2)n1.
What is the InChIKey of 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-phenylphenyl)-1,3-thiazole;ethanol?
The InChIKey is IWSLPEXWSRVODY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3S.C2H6O/c1-16-14-17(2)25(24-16)13-12-22-23-21(15-26-22)20-10-8-19(9-11-20)18-6-4-3-5-7-18;1-2-3/h3-11,14-15H,12-13H2,1-2H3;3H,2H2,1H3.
What are the key properties of 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-phenylphenyl)-1,3-thiazole;ethanol?
2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-phenylphenyl)-1,3-thiazole;ethanol has a molecular weight of 405.57 g/mol, XLogP of 5.53, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(3,5-dimethylpyrazol-1-yl)ethyl]-4-(4-phenylphenyl)-1,3-thiazole;ethanol is sourced from PubChem (CID 15944745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).