About 3-(5-benzyl-1,3-thiazol-2-yl)-2-imino-5-phenyl-1,3-thiazolidin-4-one
3-(5-benzyl-1,3-thiazol-2-yl)-2-imino-5-phenyl-1,3-thiazolidin-4-one (PubChem CID 15944770) has the molecular formula C19H15N3OS2
and a molecular weight of 365.48 g/mol. Its IUPAC name is 3-(5-benzyl-1,3-thiazol-2-yl)-2-imino-5-phenyl-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 3-(5-benzyl-1,3-thiazol-2-yl)-2-imino-5-phenyl-1,3-thiazolidin-4-one |
| PubChem CID | 15944770 |
| Molecular Formula | C19H15N3OS2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.07 |
| IUPAC Name | 3-(5-benzyl-1,3-thiazol-2-yl)-2-imino-5-phenyl-1,3-thiazolidin-4-one |
| SMILES | [H]/N=C1\SC(c2ccccc2)C(=O)N1c1ncc(Cc2ccccc2)s1 |
| InChI | InChI=1S/C19H15N3OS2/c20-18-22(17(23)16(25-18)14-9-5-2-6-10-14)19-21-12-15(24-19)11-13-7-3-1-4-8-13/h1-10,12,16,20H,11H2/b20-18- |
| InChIKey | AVMXXESPIRVLPS-ZZEZOPTASA-N |
| XLogP | 4.49 |
| TPSA | 57.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-benzyl-1,3-thiazol-2-yl)-2-imino-5-phenyl-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-benzyl-1,3-thiazol-2-yl)-2-imino-5-phenyl-1,3-thiazolidin-4-one?
The IUPAC name of 3-(5-benzyl-1,3-thiazol-2-yl)-2-imino-5-phenyl-1,3-thiazolidin-4-one (CID 15944770) is 3-(5-benzyl-1,3-thiazol-2-yl)-2-imino-5-phenyl-1,3-thiazolidin-4-one.
What is the SMILES notation for 3-(5-benzyl-1,3-thiazol-2-yl)-2-imino-5-phenyl-1,3-thiazolidin-4-one?
The canonical SMILES for 3-(5-benzyl-1,3-thiazol-2-yl)-2-imino-5-phenyl-1,3-thiazolidin-4-one is [H]/N=C1\SC(c2ccccc2)C(=O)N1c1ncc(Cc2ccccc2)s1.
What is the InChIKey of 3-(5-benzyl-1,3-thiazol-2-yl)-2-imino-5-phenyl-1,3-thiazolidin-4-one?
The InChIKey is AVMXXESPIRVLPS-ZZEZOPTASA-N. The full InChI is InChI=1S/C19H15N3OS2/c20-18-22(17(23)16(25-18)14-9-5-2-6-10-14)19-21-12-15(24-19)11-13-7-3-1-4-8-13/h1-10,12,16,20H,11H2/b20-18-.
What are the key properties of 3-(5-benzyl-1,3-thiazol-2-yl)-2-imino-5-phenyl-1,3-thiazolidin-4-one?
3-(5-benzyl-1,3-thiazol-2-yl)-2-imino-5-phenyl-1,3-thiazolidin-4-one has a molecular weight of 365.48 g/mol, XLogP of 4.49, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-benzyl-1,3-thiazol-2-yl)-2-imino-5-phenyl-1,3-thiazolidin-4-one is sourced from PubChem (CID 15944770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).