C16H14F2N2O6 — CID 159447997
5-amino-2-fluoro-4-methylbenzoic acid;2-fluoro-4-methyl-5-nitrobenzoic acid (PubChem CID 159447997) has the molecular formula C16H14F2N2O6 and a molecular weight of 368.29 g/mol. Its IUPAC name is 5-amino-2-fluoro-4-methylbenzoic acid;2-fluoro-4-methyl-5-nitrobenzoic acid.
| Compound Name | 5-amino-2-fluoro-4-methylbenzoic acid;2-fluoro-4-methyl-5-nitrobenzoic acid |
|---|---|
| PubChem CID | 159447997 |
| Molecular Formula | C16H14F2N2O6 |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 5-amino-2-fluoro-4-methylbenzoic acid;2-fluoro-4-methyl-5-nitrobenzoic acid |
| SMILES | Cc1cc(F)c(C(=O)O)cc1N.Cc1cc(F)c(C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H6FNO4.C8H8FNO2/c1-4-2-6(9)5(8(11)12)3-7(4)10(13)14;1-4-2-6(9)5(8(11)12)3-7(4)10/h2-3H,1H3,(H,11,12);2-3H,10H2,1H3,(H,11,12) |
| InChIKey | LSZSEYABRHYUOZ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|