C17H20BF4NO — CID 159448179
[4-[2-(2,6-dimethylpyran-4-ylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;trifluoroborane;fluoride (PubChem CID 159448179) has the molecular formula C17H20BF4NO and a molecular weight of 341.16 g/mol. Its IUPAC name is [4-[2-(2,6-dimethylpyran-4-ylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;trifluoroborane;fluoride.
| Compound Name | [4-[2-(2,6-dimethylpyran-4-ylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;trifluoroborane;fluoride |
|---|---|
| PubChem CID | 159448179 |
| Molecular Formula | C17H20BF4NO |
| Molecular Weight | 341.16 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | [4-[2-(2,6-dimethylpyran-4-ylidene)ethylidene]cyclohexa-2,5-dien-1-ylidene]-dimethylazanium;trifluoroborane;fluoride |
| SMILES | CC1=CC(=CC=C2C=CC(=[N+](C)C)C=C2)C=C(C)O1.FB(F)F.[F-] |
| InChI | InChI=1S/C17H20NO.BF3.FH/c1-13-11-16(12-14(2)19-13)6-5-15-7-9-17(10-8-15)18(3)4;2-1(3)4;/h5-12H,1-4H3;;1H/q+1;;/p-1 |
| InChIKey | LTAISPGNUTWDDR-UHFFFAOYSA-M |
| XLogP | 1.40 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.16 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|