C28H29F9N2O3 — CID 159448436
N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-[(2S,4S)-2-cyclopropyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-yl]acetamide;propyl formate (PubChem CID 159448436) has the molecular formula C28H29F9N2O3 and a molecular weight of 612.53 g/mol. Its IUPAC name is N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-[(2S,4S)-2-cyclopropyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-yl]acetamide;propyl formate.
| Compound Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-[(2S,4S)-2-cyclopropyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-yl]acetamide;propyl formate |
|---|---|
| PubChem CID | 159448436 |
| Molecular Formula | C28H29F9N2O3 |
| Molecular Weight | 612.53 g/mol |
| Exact Mass | 612.20 |
| IUPAC Name | N-[[3,5-bis(trifluoromethyl)phenyl]methyl]-N-[(2S,4S)-2-cyclopropyl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinolin-4-yl]acetamide;propyl formate |
| SMILES | CC(=O)N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@H]1C[C@@H](C2CC2)Nc2ccc(C(F)(F)F)cc21.CCCOC=O |
| InChI | InChI=1S/C24H21F9N2O.C4H8O2/c1-12(36)35(11-13-6-16(23(28,29)30)8-17(7-13)24(31,32)33)21-10-20(14-2-3-14)34-19-5-4-15(9-18(19)21)22(25,26)27;1-2-3-6-4-5/h4-9,14,20-21,34H,2-3,10-11H2,1H3;4H,2-3H2,1H3/t20-,21-;/m0./s1 |
| InChIKey | LTBDXKHHNMSLFX-GUTACTQSSA-N |
| XLogP | 8.00 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.53 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|