About ethanethioic S-acid;methyl 2-sulfanylacetate
ethanethioic S-acid;methyl 2-sulfanylacetate (PubChem CID 159448493) has the molecular formula C5H10O3S2
and a molecular weight of 182.27 g/mol. Its IUPAC name is ethanethioic S-acid;methyl 2-sulfanylacetate.
Molecular Properties
| Compound Name | ethanethioic S-acid;methyl 2-sulfanylacetate |
| PubChem CID | 159448493 |
| Molecular Formula | C5H10O3S2 |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.01 |
| IUPAC Name | ethanethioic S-acid;methyl 2-sulfanylacetate |
| SMILES | CC(=O)S.COC(=O)CS |
| InChI | InChI=1S/C3H6O2S.C2H4OS/c1-5-3(4)2-6;1-2(3)4/h6H,2H2,1H3;1H3,(H,3,4) |
| InChIKey | LTBIXROMWRQZHM-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethanethioic S-acid;methyl 2-sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanethioic S-acid;methyl 2-sulfanylacetate?
The IUPAC name of ethanethioic S-acid;methyl 2-sulfanylacetate (CID 159448493) is ethanethioic S-acid;methyl 2-sulfanylacetate.
What is the SMILES notation for ethanethioic S-acid;methyl 2-sulfanylacetate?
The canonical SMILES for ethanethioic S-acid;methyl 2-sulfanylacetate is CC(=O)S.COC(=O)CS.
What is the InChIKey of ethanethioic S-acid;methyl 2-sulfanylacetate?
The InChIKey is LTBIXROMWRQZHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2S.C2H4OS/c1-5-3(4)2-6;1-2(3)4/h6H,2H2,1H3;1H3,(H,3,4).
What are the key properties of ethanethioic S-acid;methyl 2-sulfanylacetate?
ethanethioic S-acid;methyl 2-sulfanylacetate has a molecular weight of 182.27 g/mol, XLogP of 0.55, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethanethioic S-acid;methyl 2-sulfanylacetate is sourced from PubChem (CID 159448493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).